•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoazepines

Set Ascending Direction

   

Items 11 to 20 of 71 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-chloro-7-nitro-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 461435-44-9
    Catalog No.: 135462
    Purity: 95%
    MF: C10H11ClN2O2
    MW: 226.663
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=C(Cl)C2=C(CCNCC2)C=C1
  2. 6,7-dichloro-3-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 461435-74-5
    Catalog No.: 135461
    Purity: 95%
    MF: C11H13Cl2N
    MW: 230.138
    Storage: 2-8 degree Celsius
    SMILES: CN1CCC2=C(CC1)C(Cl)=C(Cl)C=C2
  3. 6-chloro-3-methyl-7-nitro-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 73943-11-0
    Catalog No.: 135460
    Purity: 95%
    MF: C11H13ClN2O2
    MW: 240.69
    Storage: 2-8 degree Celsius
    SMILES: CN1CCC2=C(CC1)C(Cl)=C(C=C2)[N+]([O-])=O
  4. 1,3,4,5-tetrahydro-2H-1-benzazepin-2-one

    CAS No.: 4424-80-0
    Catalog No.: 103150
    Purity: 95%
    MF: C10H11NO
    MW: 161.204
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCCC2=CC=CC=C2N1
  5. 7-fluoro-2,3,4,5-tetrahydro-1H-1,5-methanobenzo[d]azepine

    CAS No.: 328055-80-7
    Catalog No.: TQP1811
    Purity: 95%
    MF: C11H12FN
    MW: 177.222
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C3CNCC2C3)C=C1
  6. 2,3,4,5-tetrahydro-1H-1,5-methanobenzo[d]azepine-7-carbonitrile

    CAS No.: 328055-95-4
    Catalog No.: TQP1810
    Purity: 95%
    MF: C12H12N2
    MW: 184.242
    Storage: 2-8 degree Celsius
    SMILES: C12CNCC(C3=C1C=CC(=C3)C#N)C2
  7. 7,8-difluoro-2,3,4,5-tetrahydro-1H-1,5-methanobenzo[d]azepine

    CAS No.: 287973-26-6
    Catalog No.: TQP1809
    Purity: 95%
    MF: C11H11F2N
    MW: 195.212
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C3CNCC2C3)C=C1F
  8. 7,8-dichloro-2,3,4,5-tetrahydro-1H-1,5-methanobenzo[d]azepine

    CAS No.: 328055-99-8
    Catalog No.: TQP1807
    Purity: 95%
    MF: C11H11Cl2N
    MW: 228.122
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C3CNCC2C3)C=C1Cl
  9. 7-bromo-8-methoxy-3-methyl-1-phenyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 113080-94-7
    Catalog No.: 151052
    Purity: 95%
    MF: C18H20BrNO
    MW: 346.268
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(CCN(C)CC2C2=CC=CC=C2)C=C1Br
  10. 7-bromo-9-chloro-2,3-dihydrobenzo[f][1,4]oxazepine

    CAS No.: 1799626-43-9
    Catalog No.: 197517
    Purity: 95%
    MF: C9H7BrClNO
    MW: 260.518
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C2=C(C=NCCO2)C1)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 71 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5