•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azetidines

Set Ascending Direction

   

Items 61 to 70 of 404 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. tert-butyl 3-(2-iodoethyl)azetidine-1-carboxylate

    CAS No.: 158602-36-9
    Catalog No.: 170728
    Purity: 95%
    MF: C10H18INO2
    MW: 311.163
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CC(CCI)C1
  2. N-methyl-N-(oxetan-3-yl)azetidin-3-amine dihydrochloride

    CAS No.: 1403767-34-9
    Catalog No.: 170939
    Purity: 95%
    MF: C7H16Cl2N2O
    MW: 215.124
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.CN(C1CNC1)C1COC1
  3. 2-(azetidin-3-yl)propan-2-ol hydrochloride

    CAS No.: 1357923-33-1
    Catalog No.: 171084
    Purity: 95%
    MF: C6H14ClNO
    MW: 151.637
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC(C)(O)C1CNC1
  4. N-(azetidin-3-yl)methanesulfonamide hydrochloride

    CAS No.: 1239205-33-4
    Catalog No.: 171346
    Purity: 95%
    MF: C4H11ClN2O2S
    MW: 186.664
    Storage: 2-8 degree Celsius
    SMILES: Cl.CS(=O)(=O)NC1CNC1
  5. 3,3-bis(bromomethyl)-1-(4-methylbenzenesulfonyl)azetidine

    CAS No.: 1041026-61-2
    Catalog No.: 171720
    Purity: 95%
    MF: C12H15Br2NO2S
    MW: 397.132
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)S(=O)(=O)N1CC(CBr)(CBr)C1
  6. 1-[(tert-butoxy)carbonyl]-3-(ethoxycarbonyl)azetidine-3-carboxylic acid

    CAS No.: 1011479-76-7
    Catalog No.: 171766
    Purity: 95%
    MF: C12H19NO6
    MW: 273.285
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)C(O)=O
  7. tert-butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate

    CAS No.: 1002355-96-5
    Catalog No.: 171787
    Purity: 95%
    MF: C12H19NO4
    MW: 241.287
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C=C1CN(C1)C(=O)OC(C)(C)C
  8. tert-butyl 3-(hydroxymethyl)-3-methylazetidine-1-carboxylate

    CAS No.: 1363382-91-5
    Catalog No.: 177593
    Purity: 95%
    MF: C10H19NO3
    MW: 201.266
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CC(C)(CO)C1
  9. tert-butyl 3-(cyanomethyl)azetidine-1-carboxylate

    CAS No.: 142253-58-5
    Catalog No.: 186729
    Purity: 95%
    MF: C10H16N2O2
    MW: 196.25
    Storage: 2-8 degree Celsius
    SMILES: C(#N)CC1CN(C1)C(=O)OC(C)(C)C
  10. 4-(azetidin-3-yl)-1-methylpiperazin-2-one dihydrochloride

    CAS No.: 1403766-76-6
    Catalog No.: 191095
    Purity: 95%
    MF: C8H17Cl2N3O
    MW: 242.15
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1CC(C1)N1CC(N(CC1)C)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 404 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9