•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azetidines

Set Ascending Direction

   

Items 21 to 30 of 404 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 3-(4-amino-6-methyl-1H-imidazo[4,5-c]pyridin-1-yl)-3-methylazetidine-1-carboxylate

    CAS No.: 2423058-74-4
    Catalog No.: TQR1092
    Purity: 95%
    MF: C16H23N5O2
    MW: 317.393
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC(=CC2=C1N=CN2C2(CN(C2)C(=O)OC(C)(C)C)C)C
  2. 6-methyl-1-(3-methylazetidin-3-yl)-1H-imidazo[4,5-c]pyridin-4-amine hydrochloride

    CAS No.: 2423057-84-3
    Catalog No.: TQR1093
    Purity: 95%
    MF: C11H16ClN5
    MW: 253.737
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC1=CC2=C(C(=N1)N)N=CN2C2(CNC2)C
  3. tert-butyl 3-(6-chloro-9H-purin-9-yl)azetidine-1-carboxylate

    CAS No.: 2137735-36-3
    Catalog No.: TQR1097
    Purity: 95%
    MF: C13H16ClN5O2
    MW: 309.757
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CN(C2=NC=N1)C1CN(C1)C(=O)OC(C)(C)C
  4. tert-butyl 3-(6-chloro-2-methyl-9H-purin-9-yl)azetidine-1-carboxylate

    CAS No.: 2423059-01-0
    Catalog No.: TQR1098
    Purity: 95%
    MF: C14H18ClN5O2
    MW: 323.784
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CN(C2=NC(=N1)C)C1CN(C1)C(=O)OC(C)(C)C
  5. tert-butyl 3-(6-chloro-2-methyl-9H-purin-9-yl)-3-methylazetidine-1-carboxylate

    CAS No.: 2423059-03-2
    Catalog No.: TQR1099
    Purity: 95%
    MF: C15H20ClN5O2
    MW: 337.811
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CN(C2=NC(=N1)C)C1(CN(C1)C(=O)OC(C)(C)C)C
  6. 9-(azetidin-3-yl)-9H-purin-6-amine dihydrochloride

    CAS No.: 2375273-16-6
    Catalog No.: TQR1100
    Purity: 95%
    MF: C8H12Cl2N6
    MW: 263.132
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1CC(C1)N1C2=NC=NC(=C2N=C1)N
  7. 9-(azetidin-3-yl)-9H-purin-6-amine hydrochloride

    CAS No.: 1864064-67-4
    Catalog No.: TQR1101
    Purity: 95%
    MF: C8H11ClN6
    MW: 226.671
    Storage: 2-8 degree Celsius
    SMILES: Cl.N1CC(C1)N1C2=NC=NC(=C2N=C1)N
  8. 2-(4-oxo-1-(o-tolylcarbamoyl)azetidin-2-yl)acetic acid

    CAS No.: 2023788-32-9
    Catalog No.: TQR1316
    Purity: 95%
    MF: C13H14N2O4
    MW: 262.265
    Storage: 2-8 degree Celsius
    SMILES: O=C1CC(N1C(NC1=C(C=CC=C1)C)=O)CC(=O)O
  9. 2-(2-(4-oxo-1-(o-tolylcarbamoyl)azetidin-2-yl)acetamido)acetic acid

    CAS No.: 2023788-40-9
    Catalog No.: TQR1317
    Purity: 95%
    MF: C15H17N3O5
    MW: 319.317
    Storage: 2-8 degree Celsius
    SMILES: O=C1CC(N1C(NC1=C(C=CC=C1)C)=O)CC(=O)NCC(=O)O
  10. tert-butyl azetidin-3-yl(propyl)carbamate

    CAS No.: 2273511-94-5
    Catalog No.: TQR1372
    Purity: 95%
    MF: C11H22N2O2
    MW: 214.309
    Storage: 2-8 degree Celsius
    SMILES: N1CC(C1)N(C(OC(C)(C)C)=O)CCC
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 404 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5