•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azabicycloes

Set Ascending Direction

   

Items 31 to 40 of 262 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 8-methyl-8-azabicyclo[3.2.1]octan-3-one

    CAS No.: 532-24-1
    Catalog No.: 150714
    Purity: 95%
    MF: C8H13NO
    MW: 139.198
    Storage: 2-8 degree Celsius
    SMILES: CN1C2CCC1CC(=O)C2
  2. methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate hydrochloride

    CAS No.: 565456-77-1
    Catalog No.: 157404
    Purity: 95%
    MF: C9H16ClNO2
    MW: 205.685
    Storage: 2-8 degree Celsius
    SMILES: Cl.COC(=O)[C@H]1NC[C@H]2[C@@H]1C2(C)C
  3. tert-butyl (1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate

    CAS No.: 134003-84-2
    Catalog No.: 157444
    Purity: 95%
    MF: C10H18N2O2
    MW: 198.266
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CN(C(=O)OC(C)(C)C)[C@@]([H])(CN1)C2
  4. (1S,4R)-2-azabicyclo[2.2.1]hept-5-en-3-one

    CAS No.: 130931-83-8
    Catalog No.: 159641
    Purity: 95%
    MF: C6H7NO
    MW: 109.128
    Storage: 2-8 degree Celsius
    SMILES: O=C1N[C@H]2C[C@@H]1C=C2
  5. 9-azabicyclo[3.3.1]nonan-3-one

    CAS No.: 4390-39-0
    Catalog No.: 162237
    Purity: 95%
    MF: C8H13NO
    MW: 139.198
    Storage: 2-8 degree Celsius
    SMILES: O=C1CC2CCCC(C1)N2
  6. tert-butyl 8-amino-3-azabicyclo[3.2.1]octane-3-carboxylate hydrochloride

    CAS No.: 1427195-31-0
    Catalog No.: 162296
    Purity: 95%
    MF: C12H23ClN2O2
    MW: 262.781
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC(C)(C)OC(=O)N1CC2CCC(C1)C2N
  7. rel-(1R,5S,6r)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid

    CAS No.: 927679-54-7
    Catalog No.: 169783
    Purity: 95%
    MF: C11H17NO4
    MW: 227.26
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CC2C(C1)C2C(O)=O
  8. methyl (1R,3S,5S)-rel-6-oxabicyclo[3.1.0]hexane-3-carboxylate

    CAS No.: 86885-57-6
    Catalog No.: 169928
    Purity: 95%
    MF: C7H10O3
    MW: 142.154
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12CC(C[C@]1([H])O2)C(=O)OC
  9. 8-oxabicyclo[3.2.1]octan-3-one

    CAS No.: 77745-32-5
    Catalog No.: 170011
    Purity: 95%
    MF: C7H10O2
    MW: 126.155
    Storage: 2-8 degree Celsius
    SMILES: O=C1CC2CCC(C1)O2
  10. 9-methyl-9-azabicyclo[3.3.1]nonan-3-one oxime

    CAS No.: 6164-67-6
    Catalog No.: 170147
    Purity: 95%
    MF: C9H16N2O
    MW: 168.24
    Storage: 2-8 degree Celsius
    SMILES: CN1C2CCCC1CC(C2)=NO
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 262 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6