•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azabicycloes

Set Ascending Direction

   

Items 1 to 10 of 262 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 3,7-diaza-bicyclo[4.1.0]heptane-3-carboxylate

    CAS No.: 1422344-28-2
    Catalog No.: 193204
    Purity: 95%
    MF: C10H18N2O2
    MW: 198.266
    Storage: 2-8 degree Celsius
    SMILES: C12CN(CCC2N1)C(=O)OC(C)(C)C
  2. Cis-tert-butyl 1,5-dimethyl-6-oxo-3-aza-bicyclo[3.2.0]heptane-3-carboxylate

    CAS No.: 175476-93-4
    Catalog No.: 193205
    Purity: 95%
    MF: C13H21NO3
    MW: 239.315
    Storage: 2-8 degree Celsius
    SMILES: C[C@@]12CN(C[C@]2(C(C1)=O)C)C(=O)OC(C)(C)C
  3. ethyl (1R,5S)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate

    CAS No.: 184838-77-5
    Catalog No.: 193206
    Purity: 95%
    MF: C8H10O4
    MW: 170.164
    Storage: 2-8 degree Celsius
    SMILES: O=C1[C@@]2(C[C@@H]2CO1)C(=O)OCC
  4. 6-aza-bicyclo[3.2.0]heptan-7-one

    CAS No.: 22031-52-3
    Catalog No.: 193207
    Purity: 95%
    MF: C6H9NO
    MW: 111.144
    Storage: 2-8 degree Celsius
    SMILES: C12CCCC2NC1=O
  5. 8-benzyl-8-aza-bicyclo[4.3.1]decan-10-one

    CAS No.: 936110-21-3
    Catalog No.: 193209
    Purity: 95%
    MF: C16H21NO
    MW: 243.35
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1CC2CCCCC(C1)C2=O
  6. (3-benzyl-3-aza-bicyclo[3.3.1]non-9-yl)-amine

    CAS No.: 198210-86-5
    Catalog No.: 193210
    Purity: 95%
    MF: C15H22N2
    MW: 230.355
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1CC2CCCC(C1)C2N
  7. 8-benzyl-8-azabicyclo[3.2.1]octan-3-amine

    CAS No.: 96901-92-7
    Catalog No.: TQR0332
    Purity: 95%
    MF: C14H20N2
    MW: 216.328
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C2CC(CC1CC2)N
  8. 2-fluoro-5-((1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)pyridin-3-amine

    CAS No.: 2228908-69-6
    Catalog No.: TQR0597
    Purity: 95%
    MF: C11H15FN4
    MW: 222.267
    Storage: 2-8 degree Celsius
    SMILES: FC1=NC=C(C=C1N)N1[C@@H]2CN([C@H](C1)C2)C
  9. 4-chloro-N-(2-fluoro-5-((1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)pyridin-3-yl)-5-methylpyrimidin-2-amine

    CAS No.: 2228908-49-2
    Catalog No.: TQR0600
    Purity: 95%
    MF: C16H18ClFN6
    MW: 348.813
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=NC=C1C)NC=1C(=NC=C(C1)N1[C@@H]2CN([C@H](C1)C2)C)F
  10. (1R,3S,5R)-tert-butyl 3-(((tert-butyldiphenylsilyl)oxy)methyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate

    CAS No.: 197142-32-8
    Catalog No.: TQR1586
    Purity: 95%
    MF: C27H37NO3Si
    MW: 451.683
    Storage: 2-8 degree Celsius
    SMILES: [Si](C1=CC=CC=C1)(C1=CC=CC=C1)(C(C)(C)C)OC[C@H]1N([C@@H]2C[C@@H]2C1)C(=O)OC(C)(C)C
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 262 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5