•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Aryls

Set Ascending Direction

   

Items 41 to 50 of 7305 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 4-(benzyloxy)-2-fluorobenzaldehyde

    CAS No.: 504414-32-8
    Catalog No.: 193113
    Purity: 95%
    MF: C14H11FO2
    MW: 230.238
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1=CC(=C(C=O)C=C1)F
  2. (S)-2-amino-3-(benzyloxy)propan-1-ol hydrochloride

    CAS No.: 61366-43-6
    Catalog No.: 193115
    Purity: 95%
    MF: C10H16ClNO2
    MW: 217.696
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H](CO)COCC1=CC=CC=C1
  3. 2-(4-(benzyloxy)-6-nitrophenyl)acetic acid

    CAS No.: 6860-79-3
    Catalog No.: 193116
    Purity: 95%
    MF: C15H13NO5
    MW: 287.271
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1=CC=C(C(=C1)[N+](=O)[O-])CC(=O)O
  4. (S)-methyl 2-(benzyloxy)propanoate

    CAS No.: 77287-11-7
    Catalog No.: 193118
    Purity: 95%
    MF: C11H14O3
    MW: 194.23
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)O[C@H](C(=O)OC)C
  5. 4-(benzyloxy)-1-chloro-2-nitrobenzene

    CAS No.: 79035-13-5
    Catalog No.: 193119
    Purity: 95%
    MF: C13H10ClNO3
    MW: 263.68
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1=CC(=C(C=C1)Cl)[N+](=O)[O-]
  6. (R)-2-(benzyloxy)propan-1-ol

    CAS No.: 87037-69-2
    Catalog No.: 193120
    Purity: 95%
    MF: C10H14O2
    MW: 166.22
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)O[C@@H](CO)C
  7. 2-(benzyloxy)propan-1-ol

    CAS No.: 70448-03-2
    Catalog No.: 193121
    Purity: 95%
    MF: C10H14O2
    MW: 166.22
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC(CO)C
  8. tert-butyl (1-(2-bromophenyl)ethyl)carbamate

    CAS No.: 1086391-99-2
    Catalog No.: 193122
    Purity: 95%
    MF: C13H18BrNO2
    MW: 300.196
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=CC=C1)C(C)NC(OC(C)(C)C)=O
  9. 5-fluoropicolinohydrazide

    CAS No.: 1254073-41-0
    Catalog No.: 193123
    Purity: 95%
    MF: C6H6FN3O
    MW: 155.132
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=CC(=NC1)C(=O)NN
  10. (4-(oxetan-3-yl)phenyl)methanol

    CAS No.: 1781691-11-9
    Catalog No.: 193124
    Purity: 95%
    MF: C10H12O2
    MW: 164.204
    Storage: 2-8 degree Celsius
    SMILES: O1CC(C1)C1=CC=C(C=C1)CO
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 7305 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7