•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anti-infection

Set Ascending Direction

   

Items 41 to 43 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. BMS790052

    CAS No.: 1009119-65-6
    Catalog No.: 140114
    Purity: 95%
    MF: C40H52Cl2N8O6
    MW: 811.812
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C1=NC=C(N1)C1=CC=C(C=C1)C1=CC=C(C=C1)C1=CN=C(N1)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC)C(C)C
  2. Pretomanid (PA-824; PA824; PA 824; (S)-PA 824)

    CAS No.: 187235-37-6
    Catalog No.: 140130
    Purity: 95%
    MF: C14H12F3N3O5
    MW: 359.26
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CN2C[C@@H](COC2=N1)OCC1=CC=C(OC(F)(F)F)C=C1
  3. Lumefantrine

    CAS No.: 82186-77-4
    Catalog No.: 140518
    Purity: 95%
    MF: C30H32Cl3NO
    MW: 528.951
    Storage: 2-8 degree Celsius
    SMILES: CCCCN(CCCC)CC(O)C1=CC(Cl)=CC2=C1C1=CC=C(Cl)C=C1C2=CC1=CC=C(Cl)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 43 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5