•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anti-infection

Set Descending Direction

   

Items 1 to 10 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Rebapamulin

    CAS No.: 224452-66-8
    Catalog No.: 100831
    Purity: 95%
    MF: C30H47NO4S
    MW: 517.776
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12CCC(CC(C1)SCC(=O)O[C@@H]1C[C@@](C)(C=C)C(O)[C@H](C)[C@]34CCC(=O)[C@@]3([H])[C@@]1(C)[C@H](C)CC4)N2C
  2. Oseltamivir Phosphate

    CAS No.: 204255-11-8
    Catalog No.: 141595
    Purity: 95%
    MF: C16H31N2O8P
    MW: 410.404
    Storage: 2-8 degree Celsius
    SMILES: OP(O)(O)=O.CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1
  3. Cefotaxime sodium

    CAS No.: 64485-93-4
    Catalog No.: 141804
    Purity: 95%
    MF: C16H16N5NaO7S2
    MW: 477.456
    Storage: 2-8 degree Celsius
    SMILES: [Na+].[H][C@]12SCC(COC(C)=O)=C(N1C(=O)[C@H]2NC(=O)C(=N\OC)\C1=CSC(N)=N1)C([O-])=O
  4. Praziquantel

    CAS No.: 55268-74-1
    Catalog No.: 151487
    Purity: 95%
    MF: C19H24N2O2
    MW: 312.413
    Storage: 2-8 degree Celsius
    SMILES: O=C(C1CCCCC1)N1CC2N(CCC3=C2C=CC=C3)C(=O)C1
  5. Ribavirin

    CAS No.: 36791-04-5
    Catalog No.: 151705
    Purity: 95%
    MF: C8H12N4O5
    MW: 244.207
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)C1=NN(C=N1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O
  6. Besifloxacin HCl

    CAS No.: 405165-61-9
    Catalog No.: 151804
    Purity: 95%
    MF: C19H22Cl2FN3O3
    MW: 430.307
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H]1CCCCN(C1)C1=C(Cl)C2=C(C=C1F)C(=O)C(=CN2C1CC1)C(O)=O
  7. LED209

    CAS No.: 245342-14-7
    Catalog No.: 157214
    Purity: 95%
    MF: C19H17N3O2S2
    MW: 383.498
    Storage: 2-8 degree Celsius
    SMILES: O=S(=O)(NC1=CC=CC=C1)C1=CC=C(NC(=S)NC2=CC=CC=C2)C=C1
  8. Merimepodib; VX-497

    CAS No.: 198821-22-6
    Catalog No.: 169539
    Purity: 95%
    MF: C23H24N4O6
    MW: 452.467
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=CC(NC(=O)NC2=CC=CC(CNC(=O)O[C@H]3CCOC3)=C2)=C1)C1=CN=CO1
  9. Q203

    CAS No.: 1334719-95-7
    Catalog No.: 186315
    Purity: 95%
    MF: C29H28ClF3N4O2
    MW: 557.016
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC=2N(C1)C(=C(N2)CC)C(=O)NCC2=CC=C(C=C2)N2CCC(CC2)C2=CC=C(C=C2)OC(F)(F)F
  10. Remdesivir

    CAS No.: 1809249-37-3
    Catalog No.: 187519
    Purity: 95%
    MF: C27H35N6O8P
    MW: 602.585
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=NN2C1=CC(=C2)[C@]2([C@@H]([C@@H]([C@H](O2)COP(=O)(OC2=CC=CC=C2)N[C@@H](C)C(=O)OCC(CC)CC)O)O)C#N
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5