•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Angiogenesis

Set Ascending Direction

   

Items 1 to 10 of 26 total

  1. 1
  2. 2
  3. 3
  1. R406 (free base)

    CAS No.: 841290-80-0
    Catalog No.: 101146
    Purity: 95%
    MF: C22H23FN6O5
    MW: 470.461
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(NC2=NC=C(F)C(NC3=CC=C4OC(C)(C)C(=O)NC4=N3)=N2)=CC(OC)=C1OC
  2. AMG 925; AMG-925; AMG925

    CAS No.: 1401033-86-0
    Catalog No.: 133853
    Purity: 95%
    MF: C26H29N7O2
    MW: 471.565
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1CC[C@@H](CC1)N1C2=CN=CC=C2C2=CN=C(NC3=NC4=C(CN(CC4)C(=O)CO)C=C3)N=C12
  3. Piceatannol

    CAS No.: 10083-24-6
    Catalog No.: 113678
    Purity: 95%
    MF: C14H12O4
    MW: 244.246
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC(\C=C\C2=CC=C(O)C(O)=C2)=CC(O)=C1
  4. Rebastinib; DCC-2036

    CAS No.: 1020172-07-9
    Catalog No.: 113196
    Purity: 95%
    MF: C30H28FN7O3
    MW: 553.598
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=NC=CC(OC2=CC=C(NC(=O)NC3=CC(=NN3C3=CC=C4N=CC=CC4=C3)C(C)(C)C)C(F)=C2)=C1
  5. Fostamatinib; R788

    CAS No.: 901119-35-5
    Catalog No.: 111986
    Purity: 95%
    MF: C23H26FN6O9P
    MW: 580.466
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(NC2=NC=C(F)C(NC3=CC=C4OC(C)(C)C(=O)N(COP(O)(O)=O)C4=N3)=N2)=CC(OC)=C1OC
  6. PF-431396

    CAS No.: 717906-29-1
    Catalog No.: 111948
    Purity: 95%
    MF: C22H21F3N6O3S
    MW: 506.51
    Storage: 2-8 degree Celsius
    SMILES: CN(C1=CC=CC=C1CNC1=NC(NC2=CC3=C(NC(=O)C3)C=C2)=NC=C1C(F)(F)F)S(C)(=O)=O
  7. Dovitinib; TKI-258; CHIR-258

    CAS No.: 405169-16-6
    Catalog No.: 111611
    Purity: 95%
    MF: C21H21FN6O
    MW: 392.438
    Storage: 2-8 degree Celsius
    SMILES: CN1CCN(CC1)C1=CC=C2NC(=NC2=C1)C1=C(N)C2=C(NC1=O)C=CC=C2F
  8. PRT062607 (P505-15, BIIB057) HCl

    CAS No.: 1370261-97-4
    Catalog No.: 109808
    Purity: 95%
    MF: C19H24ClN9O
    MW: 429.916
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].N[C@H]1CCCC[C@H]1NC1=NC=C(C(N)=O)C(NC2=CC=C(C=C2)N2N=CC=N2)=N1
  9. BGJ398; NVP-BGJ398

    CAS No.: 872511-34-7
    Catalog No.: 109732
    Purity: 95%
    MF: C26H31Cl2N7O3
    MW: 560.486
    Storage: 2-8 degree Celsius
    SMILES: CCN1CCN(CC1)C1=CC=C(NC2=CC(=NC=N2)N(C)C(=O)NC2=C(Cl)C(OC)=CC(OC)=C2Cl)C=C1
  10. Quizartinib; AC220;AC010220

    CAS No.: 950769-58-1
    Catalog No.: 105147
    Purity: 95%
    MF: C29H32N6O4S
    MW: 560.68
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CC(NC(=O)NC2=CC=C(C=C2)C2=CN3C(SC4=CC(OCCN5CCOCC5)=CC=C34)=N2)=NO1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 26 total

  1. 1
  2. 2
  3. 3