•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Wnt/beta-catenin

Set Descending Direction

   

Items 1 to 10 of 22 total

  1. 1
  2. 2
  3. 3
  1. Wnt agonist 1

    CAS No.: 853220-52-7
    Catalog No.: 152177
    Purity: 95%
    MF: C19H18N4O3
    MW: 350.378
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=CC(=C1)C1=NC(N)=NC(NCC2=CC3=C(OCO3)C=C2)=C1
  2. Gigantol

    CAS No.: 67884-30-4
    Catalog No.: ZB1611
    Purity: 95%
    MF: C16H18O4
    MW: 274.316
    Storage: 2-8 degree Celsius
    SMILES: OC=1C=C(CCC=2C=CC(=C(C2)O)OC)C=C(C1)OC
  3. SKL2001

    CAS No.: 909089-13-0
    Catalog No.: 186463
    Purity: 95%
    MF: C14H14N4O3
    MW: 286.291
    Storage: 2-8 degree Celsius
    SMILES: N1(C=NC=C1)CCCNC(=O)C1=NOC(=C1)C=1OC=CC1
  4. iCRT3

    CAS No.: 901751-47-1
    Catalog No.: 186383
    Purity: 95%
    MF: C23H26N2O2S
    MW: 394.54
    Storage: 2-8 degree Celsius
    SMILES: C(C)C1=CC=C(C=C1)C=1OC(=C(N1)CSCC(=O)NCCC1=CC=CC=C1)C
  5. NCB-0846

    CAS No.: 1792999-26-8
    Catalog No.: 186302
    Purity: 95%
    MF: C21H21N5O2
    MW: 375.432
    Storage: 2-8 degree Celsius
    SMILES: N1C=NC2=C1C=C(C=C2)NC2=NC1=C(C=CC=C1C=N2)O[C@H]2CC[C@H](CC2)O
  6. PNU74654

    CAS No.: 113906-27-7
    Catalog No.: 186274
    Purity: 95%
    MF: C19H16N2O3
    MW: 320.348
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(O1)\C=N\NC(C1=C(C=CC=C1)OC1=CC=CC=C1)=O
  7. KYA1797K

    CAS No.: 1956356-56-1
    Catalog No.: 186263
    Purity: 95%
    MF: C17H11KN2O6S2
    MW: 442.515
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=C1)C1=CC=C(O1)\C=C\1/C(N(C(S1)=S)CCC(=O)[O-])=O.[K+]
  8. IWP-4

    CAS No.: 686772-17-8
    Catalog No.: 186206
    Purity: 95%
    MF: C23H20N4O3S3
    MW: 496.639
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=CC=C1)N1C(=NC2=C(C1=O)SCC2)SCC(=O)NC=2SC1=C(N2)C=CC(=C1)C
  9. XCT790

    CAS No.: 725247-18-7
    Catalog No.: 157186
    Purity: 95%
    MF: C23H13F9N4O3S
    MW: 596.431
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OCC2=C(C=C(C=C2)C(F)(F)F)C(F)(F)F)C=CC(C=C(C#N)C(=O)NC2=NN=C(S2)C(F)(F)F)=C1
  10. Triptonide

    CAS No.: 38647-11-9
    Catalog No.: 177373
    Purity: 95%
    MF: C21H24O6
    MW: 372.417
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12C[C@@]3([H])C4=C(CC[C@]3(C)[C@]35O[C@@]3(C)[C@]3([H])O[C@]3(C(C)C)C(=O)[C@]15O2)C(=O)OC4
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 22 total

  1. 1
  2. 2
  3. 3