•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

VEGFR

Set Descending Direction

   

Items 1 to 10 of 45 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. R1530

    CAS No.: 882531-87-5
    Catalog No.: 157289
    Purity: 95%
    MF: C18H14ClFN4O
    MW: 356.788
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(F)C=C2C(=C1)N=C1NNC(C)=C1N=C2C1=CC=CC=C1Cl
  2. Cabozantinib malate; XL184

    CAS No.: 1140909-48-3
    Catalog No.: 135210
    Purity: 95%
    MF: C32H30FN3O10
    MW: 635.601
    Storage: 2-8 degree Celsius
    SMILES: O[C@@H](CC(O)=O)C(O)=O.COC1=C(OC)C=C2C(OC3=CC=C(NC(=O)C4(CC4)C(=O)NC4=CC=C(F)C=C4)C=C3)=CC=NC2=C1
  3. Regorafenib monohydrate

    CAS No.: 1019206-88-2
    Catalog No.: 135211
    Purity: 95%
    MF: C21H17ClF4N4O4
    MW: 500.836
    Storage: 2-8 degree Celsius
  4. ZM 306416

    CAS No.: 690206-97-4
    Catalog No.: 141635
    Purity: 95%
    MF: C16H13ClFN3O2
    MW: 333.75
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OC)C=C2C(NC3=C(F)C=C(Cl)C=C3)=NC=NC2=C1
  5. ZM 323881 HCl

    CAS No.: 193000-39-4
    Catalog No.: 141634
    Purity: 95%
    MF: C22H19ClFN3O2
    MW: 411.864
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC1=C(O)C=C(NC2=NC=NC3=CC(OCC4=CC=CC=C4)=CC=C23)C(F)=C1
  6. ENMD-2076 L-(+)-Tartaric acid

    CAS No.: 1453868-32-0
    Catalog No.: 151556
    Purity: 95%
    MF: C25H31N7O6
    MW: 525.566
    Storage: 2-8 degree Celsius
    SMILES: O[C@H]([C@@H](O)C(O)=O)C(O)=O.CN1CCN(CC1)C1=CC(NC2=NNC(C)=C2)=NC(\C=C\C2=CC=CC=C2)=N1
  7. SGI-7079

    CAS No.: 1239875-86-5
    Catalog No.: 152100
    Purity: 95%
    MF: C26H26FN7
    MW: 455.541
    Storage: 2-8 degree Celsius
    SMILES: CN1CCN(CC1)C1=C(F)C=C(NC2=NC3=C(C(C)=CN3)C(=N2)C2=CC=CC(CC#N)=C2)C=C1
  8. Tanshinone IIA

    CAS No.: 568-72-9
    Catalog No.: 151654
    Purity: 95%
    MF: C19H18O3
    MW: 294.35
    Storage: 2-8 degree Celsius
    SMILES: CC1=COC2=C1C(=O)C(=O)C1=C2C=CC2=C1CCCC2(C)C
  9. TAS-115

    CAS No.: 1190836-34-0
    Catalog No.: ZB1546
    Purity: 95%
    MF: C27H23FN4O4S
    MW: 518.57
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(OC2=CC=NC3=CC(=C(C=C23)C(=O)NC)OC)C=CC(=C1)NC(=S)NC(CC1=CC=CC=C1)=O
  10. Acrizanib

    CAS No.: 1229453-99-9
    Catalog No.: ZB1557
    Purity: 95%
    MF: C20H18F3N7O2
    MW: 445.405
    Storage: 2-8 degree Celsius
    SMILES: CN1N=C(C=C1C(F)(F)F)NC(=O)N1C=CC2=CC(=CC=C12)OC1=NC=NC(=C1)CNC
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 45 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5