•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Trifluoromethyls

Set Descending Direction

   

Items 1 to 10 of 3843 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-(4-bromophenyl)-3-(trifluoromethyl)-3H-diazirine

    CAS No.: 952143-02-1
    Catalog No.: TQ0144
    Purity: 95%
    MF: C8H4BrF3N2
    MW: 265.032
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1(N=N1)C(F)(F)F
  2. 2-amino-5-bromo-4-(trifluoromethyl)pyridine

    CAS No.: 944401-56-3
    Catalog No.: 100011
    Purity: 95%
    MF: C6H4BrF3N2
    MW: 241.01
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Br)C(=C1)C(F)(F)F
  3. 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine

    CAS No.: 944401-57-4
    Catalog No.: 100012
    Purity: 95%
    MF: C12H16BF3N2O2
    MW: 288.078
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CN=C(N)C=C1C(F)(F)F
  4. 5-bromo-4-(trifluoromethyl)pyrimidin-2-amine

    CAS No.: 935534-47-7
    Catalog No.: 100050
    Purity: 95%
    MF: C5H3BrF3N3
    MW: 241.998
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Br)C(=N1)C(F)(F)F
  5. 5-chloro-3-(trifluoromethyl)pyrazin-2-amine

    CAS No.: 1364663-32-0
    Catalog No.: 100102
    Purity: 95%
    MF: C5H3ClF3N3
    MW: 197.547
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Cl)N=C1C(F)(F)F
  6. (E)-1-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)allyl)-4-(trifluoromethyl)piperidine

    CAS No.: 865652-21-7
    Catalog No.: 100269
    Purity: 95%
    MF: C15H25BF3NO2
    MW: 319.176
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)\C=C\CN1CCC(CC1)C(F)(F)F
  7. 2-amino-4-(trifluoromethyl)pyrimidin-5-ylboronic acid

    CAS No.: 1045861-30-0
    Catalog No.: 100328
    Purity: 95%
    MF: C5H5BF3N3O2
    MW: 206.92
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(B(O)O)C(=N1)C(F)(F)F
  8. 2-(trimethylsilyl)ethyl 4-(trifluoromethylsulfonyloxy)-5,6-dihydropyridine-1(2H)-carboxylate

    CAS No.: 375854-77-6
    Catalog No.: 100332
    Purity: 95%
    MF: C12H20F3NO5SSi
    MW: 375.441
    Storage: 2-8 degree Celsius
    SMILES: C[Si](C)(C)CCOC(=O)N1CCC(OS(=O)(=O)C(F)(F)F)=CC1
  9. 2-amino-6-(trifluoromethyl)nicotinic acid

    CAS No.: 890302-02-0
    Catalog No.: 100372
    Purity: 95%
    MF: C7H5F3N2O2
    MW: 206.123
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=CC(=N1)C(F)(F)F)C(O)=O
  10. 2,4-dichloro-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine

    CAS No.: 1220518-13-7
    Catalog No.: 100374
    Purity: 95%
    MF: C8H2Cl2F3N3
    MW: 268.025
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=NC2=NC(Cl)=NC(Cl)=C2C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 3843 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5