•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Triazolopyrimidines

Set Descending Direction

   

Items 1 to 10 of 26 total

  1. 1
  2. 2
  3. 3
  1. 2-(1,1-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol

    CAS No.: 1281860-66-9
    Catalog No.: TQR0233
    Purity: 95%
    MF: C8H8F2N4O
    MW: 214.175
    Storage: 2-8 degree Celsius
    SMILES: FC(C)(F)C1=NN2C(N=C(C=C2O)C)=N1
  2. 7-chloro-[1,2,4]triazolo[1,5-c]pyrimidine

    CAS No.: 1159811-23-0
    Catalog No.: 197704
    Purity: 95%
    MF: C5H3ClN4
    MW: 154.56
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=2N(C=N1)N=CN2
  3. 7-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine

    CAS No.: 24415-66-5
    Catalog No.: 196127
    Purity: 95%
    MF: C6H5ClN4
    MW: 168.587
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(=NC=2N1N=CN2)C
  4. 7-chloro-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidine

    CAS No.: 21323-71-7
    Catalog No.: 196126
    Purity: 95%
    MF: C5H4ClN5
    MW: 169.575
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)N(N=N2)C
  5. 3-benzyl-7-chloro-3H-[1,2,3]triazolo[4,5-d]pyrimidine

    CAS No.: 21410-06-0
    Catalog No.: 196125
    Purity: 95%
    MF: C11H8ClN5
    MW: 245.673
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1N=NC2=C1N=CN=C2Cl
  6. 3-methyl-5-(methylthio)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7(6H)-one

    CAS No.: 65023-35-0
    Catalog No.: ZB2175
    Purity: 95%
    MF: C6H7N5OS
    MW: 197.223
    Storage: 2-8 degree Celsius
    SMILES: CN1N=NC2=C1N=C(NC2=O)SC
  7. 8-fluoro-5-methoxy-[1,2,4]triazolo[4,3-c]pyrimidine-3(2H)-thione

    CAS No.: 166524-67-0
    Catalog No.: ZB1346
    Purity: 95%
    MF: C6H5FN4OS
    MW: 200.198
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=2N(C(=NC1)OC)C(NN2)=S
  8. 8-fluoro-5-oxo-5,6-dihydro-[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamide

    CAS No.: 1870862-40-0
    Catalog No.: ZB1269
    Purity: 95%
    MF: C5H4FN5O3S
    MW: 233.184
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=2N(C(NC1)=O)N=C(N2)S(=O)(=O)N
  9. 2-amino-6-(3-bromo-4-chlorobenzyl)-5-isopropyl-[1,2,4]triazolo[1,5-a]pyrimidin-7(4H)-one

    CAS No.: 2395020-82-1
    Catalog No.: TQR1379
    Purity: 95%
    MF: C15H15BrClN5O
    MW: 396.676
    Storage: 2-8 degree Celsius
    SMILES: NC1=NN2C(NC(=C(C2=O)CC2=CC(=C(C=C2)Cl)Br)C(C)C)=N1
  10. 2-amino-6-(2,3-dichlorobenzyl)-5-isopropyl-[1,2,4]triazolo[1,5-a]pyrimidin-7(4H)-one

    CAS No.: 2395020-78-5
    Catalog No.: TQR1378
    Purity: 95%
    MF: C15H15Cl2N5O
    MW: 352.225
    Storage: 2-8 degree Celsius
    SMILES: NC1=NN2C(NC(=C(C2=O)CC2=C(C(=CC=C2)Cl)Cl)C(C)C)=N1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 26 total

  1. 1
  2. 2
  3. 3