•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Triazines

Set Ascending Direction

   

Items 21 to 30 of 41 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-(6-(trifluoromethyl)pyridin-2-yl)-1,3,5-triazine-2,4(1H,3H)-dione

    CAS No.: 1446507-38-5
    Catalog No.: ZB2270
    Purity: 95%
    MF: C9H5F3N4O2
    MW: 258.159
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=CC=CC(=N1)C1=NC(NC(N1)=O)=O)(F)F
  2. tris(4-phenylphenyl)-1,3,5-triazine

    CAS No.: 31274-51-8
    Catalog No.: 155575
    Purity: 95%
    MF: C39H27N3
    MW: 537.666
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=C(C=C1)C1=CC=C(C=C1)C1=NC(=NC(=N1)C1=CC=C(C=C1)C1=CC=CC=C1)C1=CC=C(C=C1)C1=CC=CC=C1
  3. 3-(methylsulfonyl)-1,2,4-triazine

    CAS No.: 105783-77-5
    Catalog No.: TQ0188
    Purity: 95%
    MF: C4H5N3O2S
    MW: 159.17
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)C=1N=NC=CN1
  4. 1,3-bis(hydroxymethyl)-1,3,5-triazinan-2-one

    CAS No.: 19708-68-0
    Catalog No.: TQP1602
    Purity: 95%
    MF: C5H11N3O3
    MW: 161.161
    Storage: 2-8 degree Celsius
    SMILES: OCN1C(N(CNC1)CO)=O
  5. 1,3-diethyl-1,3,5-triazinan-2-one

    CAS No.: 104768-80-1
    Catalog No.: TQP1603
    Purity: 95%
    MF: C7H15N3O
    MW: 157.217
    Storage: 2-8 degree Celsius
    SMILES: C(C)N1C(N(CNC1)CC)=O
  6. 6-(1-aminoethyl)-3-methyl-1,2,4-triazin-5(2H)-one

    CAS No.: 84554-13-2
    Catalog No.: TQR0749
    Purity: 95%
    MF: C6H10N4O
    MW: 154.173
    Storage: 2-8 degree Celsius
    SMILES: NC(C)C=1C(N=C(NN1)C)=O
  7. 4,6-diamino-1,3,5-triazin-2(5H)-one

    CAS No.: 645-92-1
    Catalog No.: 107915
    Purity: 95%
    MF: C3H5N5O
    MW: 127.107
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC(=O)N=C(N)N1
  8. 5-bromo-6-azauracil

    CAS No.: 4956-05-2
    Catalog No.: 135309
    Purity: 95%
    MF: C3H2BrN3O2
    MW: 191.972
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NNC(=O)NC1=O
  9. potassium 4,6-dihydroxy-1,3,5-triazine-2-carboxylate

    CAS No.: 2207-75-2
    Catalog No.: 140093
    Purity: 95%
    MF: C4H2KN3O4
    MW: 195.175
    Storage: 2-8 degree Celsius
    SMILES: [K+].OC1=NC(=NC(O)=N1)C([O-])=O
  10. 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine

    CAS No.: 1472062-94-4
    Catalog No.: 147008
    Purity: 95%
    MF: C21H14ClN3
    MW: 343.817
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=NC(=N1)C1=CC=C(C=C1)C1=CC=CC=C1)C1=CC=CC=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 41 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5