•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Triazines

Set Descending Direction

   

Items 1 to 10 of 139 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methyl morpholinium chloride

    CAS No.: 3945-69-5
    Catalog No.: 102415
    Purity: 95%
    MF: C10H17ClN4O3
    MW: 276.724
    Storage: 2-8 degree Celsius
    SMILES: [Cl-].COC1=NC(=NC(OC)=N1)[N+]1(C)CCOCC1
  2. 1,3,5-triazine-2,4(1H,3H)-dione

    CAS No.: 71-33-0
    Catalog No.: 102514
    Purity: 95%
    MF: C3H3N3O2
    MW: 113.076
    Storage: 2-8 degree Celsius
  3. 2,4-dichloro-1,3,5-triazine

    CAS No.: 2831-66-5
    Catalog No.: 103190
    Purity: 95%
    MF: C3HCl2N3
    MW: 149.968
    Storage: 2-8 degree Celsius
  4. 1,3-dibromo-1,3,5-triazinane-2,4,6-trione

    CAS No.: 15114-43-9
    Catalog No.: 104472
    Purity: 95%
    MF: C3HBr2N3O3
    MW: 286.867
    Storage: 2-8 degree Celsius
    SMILES: BrN1C(=O)NC(=O)N(Br)C1=O
  5. 2,4-bis(trichlormethyl)6-methyl1,3,5-triazine

    CAS No.: 949-42-8
    Catalog No.: 104563
    Purity: 95%
    MF: C6H3Cl6N3
    MW: 329.829
    Storage: 2-8 degree Celsius
  6. 2-(4,6-diamino-1,3,5-triazin-2-yl)acetic acid

    CAS No.: 89180-20-1
    Catalog No.: 107781
    Purity: 95%
    MF: C5H7N5O2
    MW: 169.144
    Storage: 2-8 degree Celsius
  7. 4,6-diamino-1,3,5-triazin-2(5H)-one

    CAS No.: 645-92-1
    Catalog No.: 107915
    Purity: 95%
    MF: C3H5N5O
    MW: 127.107
    Storage: 2-8 degree Celsius
  8. 3-phenyl-4,5-dihydro-1,2,4-triazin-6(1H)-one

    CAS No.: 82507-66-2
    Catalog No.: 109650
    Purity: 95%
    MF: C9H9N3O
    MW: 175.191
    Storage: 2-8 degree Celsius
  9. 2-amino-4,6-dichlorotriazine

    CAS No.: 933-20-0
    Catalog No.: 111540
    Purity: 95%
    MF: C3H2Cl2N4
    MW: 164.983
    Storage: 2-8 degree Celsius
  10. 1,3,5-triazine

    CAS No.: 290-87-9
    Catalog No.: 112116
    Purity: 95%
    MF: C3H3N3
    MW: 81.078
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 139 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5