•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Triazines

Set Ascending Direction

   

Items 1 to 10 of 41 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2,4-dichloro-6-phenyl-1,3,5-triazine

    CAS No.: 1700-02-3
    Catalog No.: 129584
    Purity: 95%
    MF: C9H5Cl2N3
    MW: 226.066
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=NC(Cl)=N1)C1=CC=CC=C1
  2. ethyl 5-chloro-3-(methylthio)-1,2,4-triazine-6-carboxylate

    CAS No.: 75824-03-2
    Catalog No.: 159233
    Purity: 95%
    MF: C7H8ClN3O2S
    MW: 233.68
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=C(Cl)N=C(SC)N=N1
  3. 2-bromo-4-methyl-1,3,5-triazine

    CAS No.: 1417519-17-5
    Catalog No.: 182089
    Purity: 95%
    MF: C4H4BrN3
    MW: 174.001
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC(Br)=NC=N1
  4. 5-(4-acetylpiperazin-1-yl)-1,2,4-triazin-3(2H)-one

    CAS No.: 879639-17-5
    Catalog No.: 184672
    Purity: 95%
    MF: C9H13N5O2
    MW: 223.236
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)N1CCN(CC1)C1=NC(=O)NN=C1
  5. 5-(4-benzhydrylpiperazin-1-yl)-1,2,4-triazin-3(2H)-one

    CAS No.: 879638-00-3
    Catalog No.: 184673
    Purity: 95%
    MF: C20H21N5O
    MW: 347.422
    Storage: 2-8 degree Celsius
    SMILES: O=C1NN=CC(=N1)N1CCN(CC1)C(C1=CC=CC=C1)C1=CC=CC=C1
  6. tris(4-bromophenyl)-1,3,5-triazine

    CAS No.: 30363-03-2
    Catalog No.: 155874
    Purity: 95%
    MF: C21H12Br3N3
    MW: 546.06
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC(=NC(=N1)C1=CC=C(Br)C=C1)C1=CC=C(Br)C=C1
  7. 6-bromo-1,2,4-triazin-3-amine

    CAS No.: 69249-22-5
    Catalog No.: 182858
    Purity: 95%
    MF: C3H3BrN4
    MW: 174.989
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Br)N=N1
  8. Sodium dichloroisocyanurate dihydrate

    CAS No.: 51580-86-0
    Catalog No.: 191513
    Purity: 95%
    MF: C3H4Cl2N3NaO4
    MW: 255.977
    Storage: 2-8 degree Celsius
    SMILES: O=C1N=C([O-])N(Cl)C(N1Cl)=O.O.O.[Na+]
  9. 2-(isopropylamino)-6-phenyl-4-(phenylamino)-1,3,5-triazine 1-oxide

    CAS No.: NA
    Catalog No.: 197399
    Purity: 95%
    MF: C18H19N5O
    MW: 321.384
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)NC1=[N+](C(=NC(=N1)NC1=CC=CC=C1)C1=CC=CC=C1)[O-]
  10. 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methyl morpholinium chloride

    CAS No.: 3945-69-5
    Catalog No.: 102415
    Purity: 95%
    MF: C10H17ClN4O3
    MW: 276.724
    Storage: 2-8 degree Celsius
    SMILES: [Cl-].COC1=NC(=NC(OC)=N1)[N+]1(C)CCOCC1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 41 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5