•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Transmembrane Transporters

Set Descending Direction

   

Items 1 to 10 of 133 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (R)-2-acetamido-3-mercaptopropanamide

    CAS No.: 38520-57-9
    Catalog No.: 100951
    Purity: 95%
    MF: C5H10N2O2S
    MW: 162.214
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)N[C@@H](CS)C(N)=O
  2. Ivacaftor; VX-770; VX770

    CAS No.: 873054-44-5
    Catalog No.: 101196
    Purity: 95%
    MF: C24H28N2O3
    MW: 392.499
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CC(=C(O)C=C1NC(=O)C1=CNC2=C(C=CC=C2)C1=O)C(C)(C)C
  3. Flunarizine 2HCl

    CAS No.: 30484-77-6
    Catalog No.: 102661
    Purity: 95%
    MF: C26H28Cl2F2N2
    MW: 477.426
    Storage: 2-8 degree Celsius
  4. VX-809

    CAS No.: 936727-05-8
    Catalog No.: 104451
    Purity: 95%
    MF: C24H18F2N2O5
    MW: 452.413
    Storage: 2-8 degree Celsius
  5. Zosuquidar (LY335979) 3HCl

    CAS No.: 167465-36-3
    Catalog No.: 104922
    Purity: 95%
    MF: C32H34Cl3F2N3O2
    MW: 636.998
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.Cl.O[C@@H](COC1=C2C=CC=NC2=CC=C1)CN1CCN(CC1)[C@@H]1C2=CC=CC=C2[C@@H]2[C@H](C3=C1C=CC=C3)C2(F)F
  6. Vonoprazan Fumarate; TAK-438

    CAS No.: 881681-01-2
    Catalog No.: 104784
    Purity: 95%
    MF: C21H20FN3O6S
    MW: 461.471
    Storage: 2-8 degree Celsius
  7. Clevidipine Butyrate

    CAS No.: 167221-71-8
    Catalog No.: 108372
    Purity: 95%
    MF: C21H23Cl2NO6
    MW: 456.322
    Storage: 2-8 degree Celsius
  8. (S)-(-)-Blebbistatin

    CAS No.: 856925-71-8
    Catalog No.: 109846
    Purity: 95%
    MF: C18H16N2O2
    MW: 292.338
    Storage: 2-8 degree Celsius
  9. Brefeldin A

    CAS No.: 20350-15-6
    Catalog No.: 109741
    Purity: 95%
    MF: C16H24O4
    MW: 280.364
    Storage: 2-8 degree Celsius
  10. Isradipine

    CAS No.: 75695-93-1
    Catalog No.: 109879
    Purity: 95%
    MF: C19H21N3O5
    MW: 371.393
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC2=NON=C12)C(=O)OC(C)C
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 133 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5