•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Transmembrane Transporters

Set Ascending Direction

   

Items 21 to 30 of 133 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. PF-3716556

    CAS No.: 928774-43-0
    Catalog No.: 111964
    Purity: 95%
    MF: C22H26N4O3
    MW: 394.475
    Storage: 2-8 degree Celsius
  2. Glyburide; Glibenclamide

    CAS No.: 10238-21-8
    Catalog No.: 112438
    Purity: 95%
    MF: C23H28ClN3O5S
    MW: 494.013
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1
  3. Verapamil HCl

    CAS No.: 152-11-4
    Catalog No.: 126353
    Purity: 95%
    MF: C27H39ClN2O4
    MW: 491.072
    Storage: 2-8 degree Celsius
  4. Amiodarone HCl

    CAS No.: 19774-82-4
    Catalog No.: 129251
    Purity: 95%
    MF: C25H30ClI2NO3
    MW: 681.78
    Storage: 2-8 degree Celsius
    SMILES: Cl.CCCCC1=C(C(=O)C2=CC(I)=C(OCCN(CC)CC)C(I)=C2)C2=CC=CC=C2O1
  5. Felodipine

    CAS No.: 72509-76-3
    Catalog No.: 131637
    Purity: 95%
    MF: C18H19Cl2NO4
    MW: 384.259
    Storage: 2-8 degree Celsius
  6. CB-5083; CB5083

    CAS No.: 1542705-92-9
    Catalog No.: 134942
    Purity: 95%
    MF: C24H23N5O2
    MW: 413.481
    Storage: 2-8 degree Celsius
  7. Esomeprazole Magnesium

    CAS No.: 161973-10-0
    Catalog No.: 136200
    Purity: 95%
    MF: C34H36MgN6O6S2
    MW: 713.12
    Storage: 2-8 degree Celsius
  8. Nilvadipine; ARC029

    CAS No.: 75530-68-6
    Catalog No.: 139062
    Purity: 95%
    MF: C19H19N3O6
    MW: 385.376
    Storage: 2-8 degree Celsius
  9. Lansoprazole

    CAS No.: 103577-45-3
    Catalog No.: 139681
    Purity: 95%
    MF: C16H14F3N3O2S
    MW: 369.368
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(OCC(F)(F)F)C=CN=C1CS(=O)C1=NC2=CC=CC=C2N1
  10. Ranolazine Dihydrochloride

    CAS No.: 95635-56-6
    Catalog No.: 139689
    Purity: 95%
    MF: C24H35Cl2N3O4
    MW: 500.467
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.COC1=C(OCC(O)CN2CCN(CC(=O)NC3=C(C)C=CC=C3C)CC2)C=CC=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 133 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5