•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Topoisomerase

Set Descending Direction

   

Items 1 to 10 of 52 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Exatecan Mesylate

    CAS No.: 169869-90-3
    Catalog No.: 186342
    Purity: 95%
    MF: C25H26FN3O7S
    MW: 531.562
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(O)=O.O=C1[C@@](CC)(O)C2=C(CO1)C(N3CC4=C5C6=C(CC[C@@H]5N)C(C)=C(F)C=C6N=C4C3=C2)=O
  2. Norfloxacin

    CAS No.: 70458-96-7
    Catalog No.: 151452
    Purity: 95%
    MF: C16H18FN3O3
    MW: 319.336
    Storage: 2-8 degree Celsius
    SMILES: CCN1C=C(C(O)=O)C(=O)C2=C1C=C(N1CCNCC1)C(F)=C2
  3. Pirarubicin

    CAS No.: 72496-41-4
    Catalog No.: 151430
    Purity: 95%
    MF: C32H37NO12
    MW: 627.643
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=CC2=C1C(=O)C1=C(O)C3=C(C[C@](O)(C[C@@H]3O[C@H]3C[C@H](N)[C@H](O[C@H]4CCCCO4)[C@H](C)O3)C(=O)CO)C(O)=C1C2=O
  4. Teniposide

    CAS No.: 29767-20-2
    Catalog No.: 151507
    Purity: 95%
    MF: C32H32O13S
    MW: 656.662
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]1(O[C@H]2C3COC(=O)C3[C@H](C3=CC(OC)=C(O)C(OC)=C3)C3=C2C=C2OCOC2=C3)O[C@]2([H])CO[C@H](O[C@@]2([H])[C@H](O)[C@H]1O)C1=CC=CS1
  5. Betulinic acid

    CAS No.: 472-15-1
    Catalog No.: 151842
    Purity: 95%
    MF: C30H48O3
    MW: 456.711
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12[C@@H](CC[C@@]1(CC[C@]1(C)[C@@]2([H])CC[C@]2([H])[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O)C(C)=C
  6. Mitoxantrone HCl

    CAS No.: 70476-82-3
    Catalog No.: 151698
    Purity: 95%
    MF: C22H30Cl2N4O6
    MW: 517.41
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.OCCNCCNC1=C2C(=O)C3=C(O)C=CC(O)=C3C(=O)C2=C(NCCNCCO)C=C1
  7. Nalidixic acid

    CAS No.: 389-08-2
    Catalog No.: 151633
    Purity: 95%
    MF: C12H12N2O3
    MW: 232.239
    Storage: 2-8 degree Celsius
    SMILES: CCN1C=C(C(O)=O)C(=O)C2=CC=C(C)N=C12
  8. Pefloxacin Mesylate Dihydrate

    CAS No.: 149676-40-4
    Catalog No.: 151878
    Purity: 95%
    MF: C18H24FN3O6S
    MW: 429.47
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CCN1C=C(C(O)=O)C(=O)C2=C1C=C(N1CCN(C)CC1)C(F)=C2
  9. Voreloxin; SNS-595

    CAS No.: 175414-77-4
    Catalog No.: 152014
    Purity: 95%
    MF: C18H19N5O4S
    MW: 401.448
    Storage: 2-8 degree Celsius
    SMILES: CN[C@H]1CN(C[C@@H]1OC)C1=CC=C2C(=O)C(=CN(C3=NC=CS3)C2=N1)C(O)=O
  10. Topotecan acetate

    CAS No.: 123948-88-9
    Catalog No.: 182893
    Purity: 95%
    MF: C25H27N3O7
    MW: 481.505
    Storage: 2-8 degree Celsius
    SMILES: CC(O)=O.O=C1[C@](O)(CC)C2=C(CO1)C(N3CC4=CC5=C(CN(C)C)C(O)=CC=C5N=C4C3=C2)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 52 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5