•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiopyrans

Set Descending Direction

   

Items 1 to 10 of 57 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-(aminomethyl)thiochroman-4-ol

    CAS No.: 1528930-01-9
    Catalog No.: TQR1557
    Purity: 95%
    MF: C10H13NOS
    MW: 195.287
    Storage: 2-8 degree Celsius
    SMILES: NCC1(CCSC2=CC=CC=C12)O
  2. 2-(1,1-dioxidotetrahydro-2H-thiopyran-4-yl)ethanamine

    CAS No.: 1247501-81-0
    Catalog No.: 171321
    Purity: 95%
    MF: C7H15NO2S
    MW: 177.269
    Storage: 2-8 degree Celsius
    SMILES: NCCC1CCS(=O)(=O)CC1
  3. (1,1-dioxidotetrahydro-2H-thiopyran-4-yl)acetic acid

    CAS No.: 1224869-02-6
    Catalog No.: 171411
    Purity: 95%
    MF: C7H12O4S
    MW: 192.236
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CC1CCS(=O)(=O)CC1
  4. ethyl 4-oxotetrahydro-2H-thiopyran-3-carboxylate

    CAS No.: 1198-44-3
    Catalog No.: 191656
    Purity: 95%
    MF: C8H12O3S
    MW: 188.248
    Storage: 2-8 degree Celsius
    SMILES: O=C1C(CSCC1)C(=O)OCC
  5. methyl tetrahydro-2H-thiopyran-4-carboxylate 1,1-dioxide

    CAS No.: 917807-18-2
    Catalog No.: LT0004
    Purity: 95%
    MF: C7H12O4S
    MW: 192.236
    Storage: 2-8 degree Celsius
    SMILES: S1(CCC(CC1)C(=O)OC)(=O)=O
  6. 4-(2-chlorophenyl)tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide

    CAS No.: NA
    Catalog No.: LT0014
    Purity: 95%
    MF: C12H13ClO4S
    MW: 288.752
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC=C1)C1(CCS(CC1)(=O)=O)C(=O)O
  7. 4-(4-chlorophenyl)tetrahydro-2H-thiopyran-4-ol

    CAS No.: 853886-99-4
    Catalog No.: LT0016
    Purity: 95%
    MF: C11H13ClOS
    MW: 228.744
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C1(CCSCC1)O
  8. 4-(4-fluorophenyl)tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide

    CAS No.: NA
    Catalog No.: LT0017
    Purity: 95%
    MF: C12H13FO4S
    MW: 272.297
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)C1(CCS(CC1)(=O)=O)C(=O)O
  9. 4-amino-4-(3-fluorophenyl)tetrahydro-2H-thiopyran 1,1-dioxide

    CAS No.: 2275871-59-3
    Catalog No.: LT0026
    Purity: 95%
    MF: C11H14FNO2S
    MW: 243.303
    Storage: 2-8 degree Celsius
    SMILES: NC1(CCS(CC1)(=O)=O)C1=CC(=CC=C1)F
  10. 4-(3-fluorophenyl)tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide

    CAS No.: NA
    Catalog No.: LT0027
    Purity: 95%
    MF: C12H13FO4S
    MW: 272.297
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=C(C=CC1)C1(CCS(CC1)(=O)=O)C(=O)O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 57 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5