•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiopyrans

Set Ascending Direction

   

Items 21 to 30 of 57 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-(tetrahydro-2H-thiopyran-4-yl)hydrazine

    CAS No.: 683744-65-2
    Catalog No.: WLZ2269
    Purity: 95%
    MF: C5H12N2S
    MW: 132.232
    Storage: 2-8 degree Celsius
    SMILES: S1CCC(CC1)NN
  2. tetrahydro-2H-thiopyran-4-ol

    CAS No.: 29683-23-6
    Catalog No.: 181064
    Purity: 95%
    MF: C5H10OS
    MW: 118.201
    Storage: 2-8 degree Celsius
    SMILES: OC1CCSCC1
  3. 2-amino-4,7-dihydro-5H-thieno[2,3-c]thiopyran-3-carboxamide

    CAS No.: 173281-09-9
    Catalog No.: ZB0563
    Purity: 95%
    MF: C8H10N2OS2
    MW: 214.315
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C2=C(CSCC2)S1)C(=O)N
  4. 2-(1,1-dioxidotetrahydro-2H-thiopyran-4-yl)ethyl methanesulfonate

    CAS No.: 1010836-46-0
    Catalog No.: 195463
    Purity: 95%
    MF: C7H14O5S2
    MW: 242.318
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)OCC1CCS(CC1)(=O)=O
  5. tert-butyl (1,1-dioxido-3,4-dihydro-2H-thiopyran-4-yl)carbamate

    CAS No.: 480450-21-3
    Catalog No.: 198692
    Purity: 95%
    MF: C10H17NO4S
    MW: 247.316
    Storage: 2-8 degree Celsius
    SMILES: O=S1(CCC(C=C1)NC(OC(C)(C)C)=O)=O
  6. ethyl 2-(tetrahydro-2H-thiopyran-4-yl)acetate

    CAS No.: 218624-29-4
    Catalog No.: 198871
    Purity: 95%
    MF: C9H16O2S
    MW: 188.292
    Storage: 2-8 degree Celsius
    SMILES: O=C(OCC)CC1CCSCC1
  7. (3S,4R)-4-aminotetrahydro-2H-thiopyran-3-ol

    CAS No.: 1390671-00-7
    Catalog No.: 199784
    Purity: 91%
    MF: C5H11NOS
    MW: 133.216
    Storage: 2-8 degree Celsius
    SMILES: N[C@H]1[C@@H](CSCC1)O
  8. (S)-3-hydroxytetrahydro-4H-thiopyran-4-one

    CAS No.: NA
    Catalog No.: 199832
    Purity: 95%
    MF: C5H8O2S
    MW: 132.184
    Storage: 2-8 degree Celsius
    SMILES: O[C@@H]1CSCCC1=O
  9. (3S,4R)-4-aminotetrahydro-2H-thiopyran-3-ol hydrochloride

    CAS No.: NA
    Catalog No.: 199910
    Purity: 91%
    MF: C5H12ClNOS
    MW: 169.677
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@H]1[C@@H](CSCC1)O
  10. tetrahydro-4H-thiopyran-4-one

    CAS No.: 1072-72-6
    Catalog No.: 145517
    Purity: 95%
    MF: C5H8OS
    MW: 116.185
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCSCC1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 57 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5