•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiophenes

Set Descending Direction

   

Items 1 to 10 of 1156 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 3-amino-5-bromothiophene-2-carboxylate

    CAS No.: 107818-55-3
    Catalog No.: 100046
    Purity: 95%
    MF: C6H6BrNO2S
    MW: 236.09
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=C(N)C=C(Br)S1
  2. ethyl 2-amino-5-propylthiophene-3-carboxylate

    CAS No.: 76575-31-0
    Catalog No.: 100289
    Purity: 95%
    MF: C10H15NO2S
    MW: 213.302
    Storage: 2-8 degree Celsius
  3. ethyl 2-amino-5-ethylthiophene-3-carboxylate

    CAS No.: 4507-13-5
    Catalog No.: 100293
    Purity: 95%
    MF: C9H13NO2S
    MW: 199.275
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=C(N)SC(CC)=C1
  4. 3-(5-nitrothiophen-2-yl)acrylic acid

    CAS No.: 17163-22-3
    Catalog No.: 100317
    Purity: 95%
    MF: C7H5NO4S
    MW: 199.187
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C\C1=CC=C(S1)[N+]([O-])=O
  5. 1-(5-bromo-4-methylthiophen-2-yl)ethanone

    CAS No.: 859199-06-7
    Catalog No.: 100531
    Purity: 95%
    MF: C7H7BrOS
    MW: 219.103
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)C1=CC(C)=C(Br)S1
  6. N-((5-bromothiophen-2-yl)methyl)-2-methylpropan-1-amine

    CAS No.: 1019531-99-7
    Catalog No.: 100538
    Purity: 95%
    MF: C9H14BrNS
    MW: 248.189
    Storage: 2-8 degree Celsius
  7. N-(2-chloropyridin-4-yl)thiophene-2-carboxamide

    CAS No.: 943408-95-5
    Catalog No.: 100612
    Purity: 95%
    MF: C10H7ClN2OS
    MW: 238.699
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC(NC(=O)C2=CC=CS2)=C1
  8. methyl 3-amino-5-(2-methoxyphenyl)thiophene-2-carboxylate

    CAS No.: 354811-94-2
    Catalog No.: 100756
    Purity: 95%
    MF: C13H13NO3S
    MW: 263.318
    Storage: 2-8 degree Celsius
  9. 2,2'-bithiophen-5-ylmethanamine

    CAS No.: 4380-96-5
    Catalog No.: 100766
    Purity: 95%
    MF: C9H9NS2
    MW: 195.312
    Storage: 2-8 degree Celsius
    SMILES: NCC1=CC=C(S1)C1=CC=CS1
  10. 5-phenylthiophene-2-carbaldehyde

    CAS No.: 19163-21-4
    Catalog No.: 100767
    Purity: 95%
    MF: C11H8OS
    MW: 188.251
    Storage: 2-8 degree Celsius
    SMILES: O=CC1=CC=C(S1)C1=CC=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 1156 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5