•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiophenes

Set Descending Direction

   

Items 1 to 10 of 399 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-nitrothiophene-2-carbaldehyde

    CAS No.: 4521-33-9
    Catalog No.: LT0046
    Purity: 95%
    MF: C5H3NO3S
    MW: 157.15
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(S1)C=O
  2. methyl 2-amino-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate

    CAS No.: 184174-81-0
    Catalog No.: TQ0128
    Purity: 95%
    MF: C11H15NO2S
    MW: 225.313
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C2=C(S1)CCCCC2)C(=O)OC
  3. tert-butyl (4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)carbamate

    CAS No.: 943323-78-2
    Catalog No.: TQP0781
    Purity: 95%
    MF: C15H24BNO4S
    MW: 325.239
    Storage: 2-8 degree Celsius
    SMILES: CC1(OB(OC1(C)C)C=1C=C(SC1)NC(OC(C)(C)C)=O)C
  4. 4-(5-chlorothiophene-2-sulfonamido)benzoic acid

    CAS No.: 329906-72-1
    Catalog No.: TQP0800
    Purity: 95%
    MF: C11H8ClNO4S2
    MW: 317.775
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(S1)S(=O)(=O)NC1=CC=C(C(=O)O)C=C1
  5. (5-bromobenzo[b]thiophen-2-yl)methanol

    CAS No.: 13771-72-7
    Catalog No.: TQP1605
    Purity: 95%
    MF: C9H7BrOS
    MW: 243.125
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(SC(=C2)CO)C=C1
  6. 5-bromo-2-ethylbenzo[b]thiophene

    CAS No.: 360044-66-2
    Catalog No.: TQP1606
    Purity: 95%
    MF: C10H9BrS
    MW: 241.153
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(SC(=C2)CC)C=C1
  7. 5-bromo-2-(bromomethyl)benzo[b]thiophene

    CAS No.: 128104-93-8
    Catalog No.: TQP1607
    Purity: 95%
    MF: C9H6Br2S
    MW: 306.022
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(SC(=C2)CBr)C=C1
  8. 7-bromo-2-methylbenzo[b]thiophene

    CAS No.: 75288-49-2
    Catalog No.: TQP1608
    Purity: 95%
    MF: C9H7BrS
    MW: 227.126
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=CC2=C1SC(=C2)C
  9. 6-bromo-2-methylbenzo[b]thiophene

    CAS No.: 912332-92-4
    Catalog No.: TQP1609
    Purity: 95%
    MF: C9H7BrS
    MW: 227.126
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC2=C(SC(=C2)C)C1
  10. 5-chloro-2-methylbenzo[b]thiophene

    CAS No.: 30489-80-6
    Catalog No.: TQP1610
    Purity: 95%
    MF: C9H7ClS
    MW: 182.675
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(SC(=C2)C)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 399 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5