•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiomorpholines

Set Ascending Direction

   

Items 31 to 40 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 2-(2-ethoxy-2-oxoethyl)thiomorpholine-4-carboxylate 1,1-dioxide

    CAS No.: 1648864-64-5
    Catalog No.: 129702
    Purity: 95%
    MF: C13H23NO6S
    MW: 321.395
    Storage: 2-8 degree Celsius
  2. tert-butyl 2-(2-hydroxyethyl)thiomorpholine-4-carboxylate 1,1-dioxide

    CAS No.: 1648864-65-6
    Catalog No.: 129703
    Purity: 95%
    MF: C11H21NO5S
    MW: 279.358
    Storage: 2-8 degree Celsius
  3. tert-butyl 2-(2-(tosyloxy)ethyl)thiomorpholine-4-carboxylate 1,1-dioxide

    CAS No.: 1648864-63-4
    Catalog No.: 129704
    Purity: 95%
    MF: C18H27NO7S2
    MW: 433.548
    Storage: 2-8 degree Celsius
  4. 4-(4-bromo-phenyl)-thiomorpholine 1,1-dioxide

    CAS No.: 1093878-42-2
    Catalog No.: 131107
    Purity: 95%
    MF: C10H12BrNO2S
    MW: 290.182
    Storage: 2-8 degree Celsius
  5. thiomorpholine-3-carboxylic acid

    CAS No.: 20960-92-3
    Catalog No.: 161478
    Purity: 95%
    MF: C5H9NO2S
    MW: 147.199
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1CSCCN1
  6. thiomorpholine-2-carboxylic acid hydrochloride

    CAS No.: 88492-50-6
    Catalog No.: 161479
    Purity: 95%
    MF: C5H10ClNO2S
    MW: 183.66
    Storage: 2-8 degree Celsius
    SMILES: Cl.OC(=O)C1CNCCS1
  7. 4-(thiomorpholin-4-yl)aniline

    CAS No.: 22589-35-1
    Catalog No.: 102423
    Purity: 95%
    MF: C10H14N2S
    MW: 194.303
    Storage: 2-8 degree Celsius
  8. 4-(4-amino-2-fluorophenyl)thiomorpholine 1,1-dioxide

    CAS No.: 1126430-27-0
    Catalog No.: 187588
    Purity: 95%
    MF: C10H13FN2O2S
    MW: 244.291
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC(=C(C=C1)N1CCS(CC1)(=O)=O)F
  9. ethyl thiomorpholine-3-carboxylate hydrochloride

    CAS No.: 159381-07-4
    Catalog No.: 161881
    Purity: 95%
    MF: C7H14ClNO2S
    MW: 211.714
    Storage: 2-8 degree Celsius
    SMILES: Cl.CCOC(=O)C1CSCCN1
  10. ethyl thiomorpholine-3-carboxylate

    CAS No.: 58729-31-0
    Catalog No.: 161882
    Purity: 95%
    MF: C7H13NO2S
    MW: 175.253
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1CSCCN1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5