•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiomorpholines

Set Ascending Direction

   

Items 21 to 30 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. thiomorpholine-1,1-dioxide

    CAS No.: 39093-93-1
    Catalog No.: 182714
    Purity: 95%
    MF: C4H9NO2S
    MW: 135.188
    Storage: 2-8 degree Celsius
    SMILES: O=S1(=O)CCNCC1
  2. 3-phenylthiomorpholine

    CAS No.: 141849-62-9
    Catalog No.: 196119
    Purity: 95%
    MF: C10H13NS
    MW: 179.288
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1NCCSC1
  3. trifluoro(thiomorpholinomethyl)borate potassium(I)

    CAS No.: 1150654-80-0
    Catalog No.: 197696
    Purity: 95%
    MF: C5H10BF3KNS
    MW: 223.113
    Storage: 2-8 degree Celsius
    SMILES: F[B-](F)(F)CN1CCSCC1.[K+]
  4. 4-(2-(2-bromophenoxy)ethyl)thiomorpholine

    CAS No.: 1823235-00-2
    Catalog No.: 197697
    Purity: 95%
    MF: C12H16BrNOS
    MW: 302.237
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(OCCN2CCSCC2)C=CC=C1
  5. thiomorpholine-2-carboxylic acid

    CAS No.: 134676-66-7
    Catalog No.: 161480
    Purity: 95%
    MF: C5H9NO2S
    MW: 147.199
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1CNCCS1
  6. 4-(tert-butoxycarbonyl)thiomorpholine-2-carboxylic acid

    CAS No.: 134676-67-8
    Catalog No.: 106143
    Purity: 95%
    MF: C10H17NO4S
    MW: 247.316
    Storage: 2-8 degree Celsius
  7. N-methyl-1H-benzo[d]imidazol-2-amine

    CAS No.: 17228-38-5
    Catalog No.: 110233
    Purity: 95%
    MF: C8H9N3
    MW: 147.181
    Storage: 2-8 degree Celsius
  8. 4-(tert-butoxycarbonyl)thiomorpholine-3-carboxylic acid

    CAS No.: 128453-98-5
    Catalog No.: 110234
    Purity: 95%
    MF: C10H17NO4S
    MW: 247.316
    Storage: 2-8 degree Celsius
  9. thiomorpholine-1,1-dioxide hydrochloride

    CAS No.: 59801-62-6
    Catalog No.: 112451
    Purity: 95%
    MF: C4H10ClNO2S
    MW: 171.649
    Storage: 2-8 degree Celsius
  10. tert-butyl 2-(hydroxymethyl)thiomorpholine-4-carboxylate

    CAS No.: 911223-24-0
    Catalog No.: 129701
    Purity: 95%
    MF: C10H19NO3S
    MW: 233.333
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5