•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thienopyrroles

Set Ascending Direction

   

Items 11 to 20 of 28 total

  1. 1
  2. 2
  3. 3
  1. methyl 6H-thieno[2,3-b]pyrrole-5-carboxylate

    CAS No.: 118465-49-9
    Catalog No.: 182495
    Purity: 95%
    MF: C8H7NO2S
    MW: 181.216
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC2=C(N1)SC=C2
  2. 6H-thieno[2,3-b]pyrrole-5-carboxylic acid

    CAS No.: 51856-25-8
    Catalog No.: 182490
    Purity: 95%
    MF: C7H5NO2S
    MW: 167.189
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC2=C(N1)SC=C2
  3. 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylic acid

    CAS No.: 332099-03-3
    Catalog No.: 180978
    Purity: 95%
    MF: C7H4ClNO2S
    MW: 201.634
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC2=C(N1)SC(Cl)=C2
  4. 6-iodopyrrolo[2,1-f][1,2,4]triazin-4(3H)-one

    CAS No.: 1201784-97-5
    Catalog No.: 150658
    Purity: 95%
    MF: C6H4IN3O
    MW: 261.022
    Storage: 2-8 degree Celsius
    SMILES: IC1=CN2N=CNC(=O)C2=C1
  5. ethyl 2-bromo-6-formyl-4-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylate

    CAS No.: 1221186-55-5
    Catalog No.: 101855
    Purity: 95%
    MF: C11H10BrNO3S
    MW: 316.176
    Storage: 2-8 degree Celsius
  6. 6H-thieno[2,3-b]pyrrole

    CAS No.: 250-79-3
    Catalog No.: 194510
    Purity: 95%
    MF: C6H5NS
    MW: 123.18
    Storage: 2-8 degree Celsius
    SMILES: S1C=CC2=C1NC=C2
  7. ethyl 6H-thieno[2,3-b]pyrrole-5-carboxylate

    CAS No.: 35357-56-3
    Catalog No.: 194492
    Purity: 95%
    MF: C9H9NO2S
    MW: 195.243
    Storage: 2-8 degree Celsius
    SMILES: S1C=CC2=C1NC(=C2)C(=O)OCC
  8. 4-(2-ethylhexyl)-4H-thieno[3,2-b]pyrrole-5,6-dione

    CAS No.: 1147124-46-6
    Catalog No.: 184454
    Purity: 95%
    MF: C14H19NO2S
    MW: 265.378
    Storage: 2-8 degree Celsius
    SMILES: CCCCC(CC)CN1C(=O)C(=O)C2=C1C=CS2
  9. ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate

    CAS No.: 332099-35-1
    Catalog No.: 148004
    Purity: 95%
    MF: C9H8BrNO2S
    MW: 274.139
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=CC2=C(N1)C(Br)=CS2
  10. methyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate

    CAS No.: 1105187-36-7
    Catalog No.: 137574
    Purity: 95%
    MF: C8H6BrNO2S
    MW: 260.112
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 28 total

  1. 1
  2. 2
  3. 3