•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thienopyrroles

Set Descending Direction

   

Items 1 to 10 of 28 total

  1. 1
  2. 2
  3. 3
  1. ethyl 4-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylate

    CAS No.: 1007387-93-0
    Catalog No.: 195161
    Purity: 95%
    MF: C9H8BrNO2S
    MW: 274.139
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C2=C(NC1C(=O)OCC)SC=C2
  2. tert-butyl 5,6-dioxo-5,6-dihydro-4H-thieno[3,2-b]pyrrole-4-carboxylate

    CAS No.: 2088056-12-4
    Catalog No.: WLZ3381
    Purity: 95%
    MF: C11H11NO4S
    MW: 253.279
    Storage: 2-8 degree Celsius
    SMILES: O=C1C(C2=C(N1C(=O)OC(C)(C)C)C=CS2)=O
  3. cis-hexahydro-1H-thieno[3,4-c]pyrrole hydrochloride

    CAS No.: 179339-70-9
    Catalog No.: 195455
    Purity: 95%
    MF: C6H12ClNS
    MW: 165.689
    Storage: 2-8 degree Celsius
    SMILES: Cl.C1SC[C@@H]2[C@H]1CNC2
  4. 5-Octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione

    CAS No.: 773881-43-9
    Catalog No.: ZB0803
    Purity: 95%
    MF: C14H19NO2S
    MW: 265.378
    Storage: 2-8 degree Celsius
    SMILES: C(CCCCCCC)N1C(C=2C(C1=O)=CSC2)=O
  5. 1,3-Dibromo-5-dodecyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione

    CAS No.: 773881-47-3
    Catalog No.: ZB0792
    Purity: 95%
    MF: C18H25Br2NO2S
    MW: 479.278
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=C2C1C(N(C2=O)CCCCCCCCCCCC)=O)Br
  6. 6-methyl-6H-thieno[2,3-b]pyrrole-5-carboxylicacid

    CAS No.: 1554281-31-0
    Catalog No.: 194527
    Purity: 95%
    MF: C8H7NO2S
    MW: 181.216
    Storage: 2-8 degree Celsius
    SMILES: CN1C2=C(C=C1C(=O)O)C=CS2
  7. methyl 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylate

    CAS No.: 1803604-59-2
    Catalog No.: 194488
    Purity: 95%
    MF: C8H6BrNO2S
    MW: 260.112
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(NC(=C2)C(=O)OC)S1
  8. methyl 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate

    CAS No.: 403860-10-6
    Catalog No.: 194482
    Purity: 95%
    MF: C8H6ClNO2S
    MW: 215.661
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NC(=C2)C(=O)OC)S1
  9. 4-octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole

    CAS No.: 141029-75-6
    Catalog No.: 186125
    Purity: 95%
    MF: C16H21NS2
    MW: 291.485
    Storage: 2-8 degree Celsius
    SMILES: C(CCCCCCC)N1C2=C(C3=C1C=CS3)SC=C2
  10. ethyl 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate

    CAS No.: 332099-01-1
    Catalog No.: 182527
    Purity: 95%
    MF: C9H8ClNO2S
    MW: 229.688
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=CC2=C(N1)SC(Cl)=C2
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 28 total

  1. 1
  2. 2
  3. 3