•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thienopyridines

Set Ascending Direction

   

Items 61 to 70 of 180 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 3-bromothieno[2,3-b]pyridine

    CAS No.: 28988-21-8
    Catalog No.: 137680
    Purity: 95%
    MF: C7H4BrNS
    MW: 214.087
    Storage: 2-8 degree Celsius
  2. 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid

    CAS No.: 58327-76-7
    Catalog No.: 137691
    Purity: 95%
    MF: C10H10N2O2S
    MW: 222.269
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(C)=C2C(N)=C(SC2=N1)C(O)=O
  3. 3-bromo-5-chlorothieno[3,2-b]pyridine

    CAS No.: 912332-40-2
    Catalog No.: 137694
    Purity: 95%
    MF: C7H3BrClNS
    MW: 248.532
    Storage: 2-8 degree Celsius
  4. 3-chlorothieno[2,3-b]pyridine-2-carboxylic acid

    CAS No.: 937640-24-9
    Catalog No.: 137707
    Purity: 95%
    MF: C8H4ClNO2S
    MW: 213.645
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=C(Cl)C2=CC=CN=C2S1
  5. 4-chloro-2-(methylthio)thieno[3,2-d]pyrimidine

    CAS No.: 176530-47-5
    Catalog No.: 137708
    Purity: 95%
    MF: C7H5ClN2S2
    MW: 216.718
    Storage: 2-8 degree Celsius
  6. 4-chloro-2-iodo-3-methylthieno[2,3-b]pyridine-5-carbonitrile

    CAS No.: 930293-15-5
    Catalog No.: 137709
    Purity: 95%
    MF: C9H4ClIN2S
    MW: 334.569
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(I)SC2=NC=C(C#N)C(Cl)=C12
  7. 2,4-dichloro-5-methylthieno[2,3-d]pyrimidine

    CAS No.: 56844-38-3
    Catalog No.: 137719
    Purity: 95%
    MF: C7H4Cl2N2S
    MW: 219.096
    Storage: 2-8 degree Celsius
  8. 4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-carboxylic acid hydrochloride

    CAS No.: 116118-99-1
    Catalog No.: 137720
    Purity: 95%
    MF: C8H10ClNO2S
    MW: 219.693
    Storage: 2-8 degree Celsius
  9. 2-bromo-6,7-dihydrothieno[3,2-c]pyridin-4(5H)-one

    CAS No.: 1078150-17-0
    Catalog No.: 137739
    Purity: 95%
    MF: C7H6BrNOS
    MW: 232.102
    Storage: 2-8 degree Celsius
  10. Thieno[2,3-b]pyridin-3-amine

    CAS No.: 26579-54-4
    Catalog No.: 137748
    Purity: 95%
    MF: C7H6N2S
    MW: 150.206
    Storage: 2-8 degree Celsius
    SMILES: NC1=CSC2=NC=CC=C12
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 180 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9