•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thienopyridines

Set Descending Direction

   

Items 1 to 10 of 179 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. thieno[3,2-c]pyridin-4(5H)-one

    CAS No.: 27685-92-3
    Catalog No.: 100193
    Purity: 95%
    MF: C7H5NOS
    MW: 151.19
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC=CC2=C1C=CS2
  2. 7-bromothieno[3,2-c]pyridin-4(5H)-one

    CAS No.: 29079-94-5
    Catalog No.: 100194
    Purity: 95%
    MF: C7H4BrNOS
    MW: 230.086
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CNC(=O)C2=C1SC=C2
  3. 4-oxo-4,5-dihydrothieno[3,2-c]pyridine-7-carbonitrile

    CAS No.: 55040-34-1
    Catalog No.: 100195
    Purity: 95%
    MF: C8H4N2OS
    MW: 176.2
    Storage: 2-8 degree Celsius
  4. 2-bromo-4-oxo-4,5-dihydrothieno[3,2-c]pyridine-7-carbonitrile

    CAS No.: 55040-43-2
    Catalog No.: 100196
    Purity: 95%
    MF: C8H3BrN2OS
    MW: 255.096
    Storage: 2-8 degree Celsius
  5. 4-chlorothieno[3,2-c]pyridine

    CAS No.: 27685-94-5
    Catalog No.: 100197
    Purity: 95%
    MF: C7H4ClNS
    MW: 169.636
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CS2
  6. 7-bromo-4-chlorothieno[3,2-c]pyridine

    CAS No.: 29064-76-4
    Catalog No.: 100198
    Purity: 95%
    MF: C7H3BrClNS
    MW: 248.532
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(Br)C2=C1C=CS2
  7. 4-chlorothieno[3,2-c]pyridine-7-carbonitrile

    CAS No.: 1261302-02-6
    Catalog No.: 100199
    Purity: 95%
    MF: C8H3ClN2S
    MW: 194.646
    Storage: 2-8 degree Celsius
  8. 2-bromo-4-chlorothieno[3,2-c]pyridine-7-carbonitrile

    CAS No.: 690635-43-9
    Catalog No.: 100200
    Purity: 95%
    MF: C8H2BrClN2S
    MW: 273.542
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(C#N)C2=C1C=C(Br)S2
  9. 4-chloro-2-phenylthieno[3,2-c]pyridine-7-carbonitrile

    CAS No.: 1361197-82-1
    Catalog No.: 101214
    Purity: 95%
    MF: C14H7ClN2S
    MW: 270.744
    Storage: 2-8 degree Celsius
  10. 5,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2(4H)-one

    CAS No.: 109904-37-2
    Catalog No.: 101825
    Purity: 95%
    MF: C7H9NOS
    MW: 155.222
    Storage: 2-8 degree Celsius
    SMILES: O=C1SC2CCNCC2=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 179 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5