•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiazolopyridines

Set Descending Direction

   

Items 1 to 10 of 83 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 7-bromo-6-nitro-2-(trifluoromethyl)thiazolo[5,4-b]pyridine

    CAS No.: 2178985-07-2
    Catalog No.: TQP1705
    Purity: 95%
    MF: C7HBrF3N3O2S
    MW: 328.069
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(=NC=C1[N+](=O)[O-])SC(=N2)C(F)(F)F
  2. 6-nitrothiazolo[4,5-b]pyridin-2-amine

    CAS No.: 874511-41-8
    Catalog No.: 142252
    Purity: 95%
    MF: C6H4N4O2S
    MW: 196.191
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC2=NC=C(C=C2S1)[N+]([O-])=O
  3. 2-chloro-6-nitrothiazolo[4,5-b]pyridine

    CAS No.: 857970-02-6
    Catalog No.: 142247
    Purity: 95%
    MF: C6H2ClN3O2S
    MW: 215.621
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CN=C2N=C(Cl)SC2=C1
  4. isothiazolo[5,4-c]pyridin-3(2H)-one 1,1-dioxide

    CAS No.: 142141-07-9
    Catalog No.: 141988
    Purity: 95%
    MF: C6H4N2O3S
    MW: 184.176
    Storage: 2-8 degree Celsius
    SMILES: O=C1NS(=O)(=O)C2=C1C=CN=C2
  5. isothiazolo[5,4-b]pyridin-3(2H)-one 1,1-dioxide

    CAS No.: 138417-40-0
    Catalog No.: 141981
    Purity: 95%
    MF: C6H4N2O3S
    MW: 184.176
    Storage: 2-8 degree Celsius
    SMILES: O=C1NS(=O)(=O)C2=NC=CC=C12
  6. 6-bromo-[1,3]thiazolo[4,5-b]pyrazin-2-amine

    CAS No.: 112342-72-0
    Catalog No.: 141949
    Purity: 95%
    MF: C5H3BrN4S
    MW: 231.078
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC2=NC=C(Br)N=C2S1
  7. 6-chlorothiazolo[4,5-b]pyridine

    CAS No.: 1780572-16-8
    Catalog No.: 192543
    Purity: 95%
    MF: C6H3ClN2S
    MW: 170.624
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2C(=NC1)N=CS2
  8. 5-bromo-thiazolo[5,4-b]pyridin-2-ylamine

    CAS No.: 934266-82-7
    Catalog No.: WLZ2303
    Purity: 95%
    MF: C6H4BrN3S
    MW: 230.09
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2C(=N1)SC(=N2)N
  9. 3,6-dibromoisothiazolo[4,3-b]pyridine

    CAS No.: 1643854-33-4
    Catalog No.: TQR0509
    Purity: 95%
    MF: C6H2Br2N2S
    MW: 293.971
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SN=C2C1N=CC(=C2)Br
  10. 6-bromoisothiazolo[4,3-b]pyridin-3-amine

    CAS No.: 1643854-27-6
    Catalog No.: TQR0508
    Purity: 95%
    MF: C6H4BrN3S
    MW: 230.09
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=2C(N=C1)=C(SN2)N
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 83 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5