•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiazoles

Set Descending Direction

   

Items 1 to 10 of 926 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-(2-amino-4-methylthiazol-5-yl)-2-bromoethanone

    CAS No.: 32519-72-5
    Catalog No.: 100098
    Purity: 92%
    MF: C6H7BrN2OS
    MW: 235.106
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C(=O)CBr
  2. 2-(tert-butoxycarbonylamino)thiazole-4-carboxylic acid

    CAS No.: 83673-98-7
    Catalog No.: 100322
    Purity: 95%
    MF: C9H12N2O4S
    MW: 244.272
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC1=NC(=CS1)C(O)=O
  3. N-(4-methylthiazol-2-yl)acetamide

    CAS No.: 7336-51-8
    Catalog No.: 100342
    Purity: 95%
    MF: C6H8N2OS
    MW: 156.21
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)NC1=NC(C)=CS1
  4. 4-methyl-5-(2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-4-yl)thiazol-2-amine

    CAS No.: 1357476-69-7
    Catalog No.: 100348
    Purity: 95%
    MF: C13H14F3N3S
    MW: 301.337
    Storage: 2-8 degree Celsius
  5. tert-butyl 4-methylthiazol-2-ylcarbamate

    CAS No.: 848472-44-6
    Catalog No.: 100420
    Purity: 95%
    MF: C9H14N2O2S
    MW: 214.29
    Storage: 2-8 degree Celsius
    SMILES: CC1=CSC(NC(=O)OC(C)(C)C)=N1
  6. N-(4-chlorothiazol-2-yl)acetamide

    CAS No.: 89283-43-2
    Catalog No.: 100421
    Purity: 95%
    MF: C5H5ClN2OS
    MW: 176.628
    Storage: 2-8 degree Celsius
  7. N-(4-oxo-4,5-dihydrothiazol-2-yl)acetamide

    CAS No.: 37641-15-9
    Catalog No.: 100422
    Purity: 95%
    MF: C5H6N2O2S
    MW: 158.182
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)NC1=NC(=O)CS1
  8. (S)-N1-(4-methylthiazol-2-yl)pyrrolidine-1,2-dicarboxamide

    CAS No.: 1217486-98-0
    Catalog No.: 100424
    Purity: 95%
    MF: C10H14N4O2S
    MW: 254.315
    Storage: 2-8 degree Celsius
  9. N-(4-methylthiazol-2-yl)-1H-imidazole-1-carboxamide

    CAS No.: 1217486-99-1
    Catalog No.: 100425
    Purity: 95%
    MF: C8H8N4OS
    MW: 208.246
    Storage: 2-8 degree Celsius
  10. (S)-N1-(thiazol-2-yl)pyrrolidine-1,2-dicarboxamide

    CAS No.: 1217487-01-8
    Catalog No.: 100426
    Purity: 95%
    MF: C9H12N4O2S
    MW: 240.288
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)[C@@H]1CCCN1C(=O)NC1=NC=CS1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 926 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5