•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiadiazoles

Set Ascending Direction

   

Items 11 to 20 of 91 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole

    CAS No.: 131986-28-2
    Catalog No.: 102834
    Purity: 95%
    MF: C7H4ClN3S
    MW: 197.65
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NSN=C1C1=CC=CN=C1
  2. 5-(benzylamino)-1,3,4-thiadiazole-2-thiol

    CAS No.: 14731-27-2
    Catalog No.: 100588
    Purity: 95%
    MF: C9H9N3S2
    MW: 223.326
    Storage: 2-8 degree Celsius
    SMILES: SC1=NN=C(NCC2=CC=CC=C2)S1
  3. 4-methyl-2-(methylamino)-1,3-thiazole-5-sulfonamide

    CAS No.: 348086-68-0
    Catalog No.: 163259
    Purity: 95%
    MF: C5H9N3O2S2
    MW: 207.28
    Storage: 2-8 degree Celsius
    SMILES: CNC1=NC(C)=C(S1)S(N)(=O)=O
  4. 2-bromo-5-(m-tolyl)-1,3,4-thiadiazole

    CAS No.: 57709-51-0
    Catalog No.: TQP1757
    Purity: 95%
    MF: C9H7BrN2S
    MW: 255.14
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=NN1)C=1C=C(C=CC1)C
  5. 2-bromo-5-(o-tolyl)-1,3,4-thiadiazole

    CAS No.: 57709-50-9
    Catalog No.: TQP1756
    Purity: 95%
    MF: C9H7BrN2S
    MW: 255.14
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=NN1)C1=C(C=CC=C1)C
  6. 2-bromo-5-(3-chlorophenyl)-1,3,4-thiadiazole

    CAS No.: 57709-57-6
    Catalog No.: TQP1755
    Purity: 95%
    MF: C8H4BrClN2S
    MW: 275.558
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=NN1)C1=CC(=CC=C1)Cl
  7. 2-bromo-5-(4-fluorophenyl)-1,3,4-thiadiazole

    CAS No.: 57709-55-4
    Catalog No.: TQP1754
    Purity: 95%
    MF: C8H4BrFN2S
    MW: 259.103
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=NN1)C1=CC=C(C=C1)F
  8. 2-bromo-5-(4-methoxyphenyl)-1,3,4-thiadiazole

    CAS No.: 57709-54-3
    Catalog No.: TQP1753
    Purity: 95%
    MF: C9H7BrN2OS
    MW: 271.139
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=NN1)C1=CC=C(C=C1)OC
  9. 2-bromo-5-(3-methoxyphenyl)-1,3,4-thiadiazole

    CAS No.: 57709-53-2
    Catalog No.: TQP1752
    Purity: 95%
    MF: C9H7BrN2OS
    MW: 271.139
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=NN1)C1=CC(=CC=C1)OC
  10. 2-bromo-5-(p-tolyl)-1,3,4-thiadiazole

    CAS No.: 57709-52-1
    Catalog No.: TQP1751
    Purity: 95%
    MF: C9H7BrN2S
    MW: 255.14
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SC(=NN1)C1=CC=C(C=C1)C
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 91 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5