•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiadiazoles

Set Descending Direction

   

Items 1 to 10 of 375 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-bromo-1,3,4-thiadiazole

    CAS No.: 61929-24-6
    Catalog No.: 100522
    Purity: 95%
    MF: C2HBrN2S
    MW: 165.015
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NN=CS1
  2. 5-(benzylamino)-1,3,4-thiadiazole-2-thiol

    CAS No.: 14731-27-2
    Catalog No.: 100588
    Purity: 95%
    MF: C9H9N3S2
    MW: 223.326
    Storage: 2-8 degree Celsius
    SMILES: SC1=NN=C(NCC2=CC=CC=C2)S1
  3. 3-cyano-4-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide

    CAS No.: 1235406-40-2
    Catalog No.: 100678
    Purity: 95%
    MF: C9H5FN4O2S2
    MW: 284.297
    Storage: 2-8 degree Celsius
  4. ethyl 5-bromo-1,2,3-thiadiazole-4-carboxylate

    CAS No.: 6439-91-4
    Catalog No.: 101339
    Purity: 95%
    MF: C5H5BrN2O2S
    MW: 237.078
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=C(Br)SN=N1
  5. 2-methyl-[1,2,5]thiadiazolidine 1,1-dioxide

    CAS No.: 67104-97-6
    Catalog No.: 102143
    Purity: 95%
    MF: C3H8N2O2S
    MW: 136.176
    Storage: 2-8 degree Celsius
  6. 3-chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole

    CAS No.: 131986-28-2
    Catalog No.: 102834
    Purity: 95%
    MF: C7H4ClN3S
    MW: 197.65
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NSN=C1C1=CC=CN=C1
  7. 4-morpholino-1,2,5-thiadiazol-3-ol

    CAS No.: 30165-97-0
    Catalog No.: 103301
    Purity: 95%
    MF: C6H9N3O2S
    MW: 187.224
    Storage: 2-8 degree Celsius
  8. 2-(chloromethyl)-5-phenyl-1,3,4-thiadiazole

    CAS No.: 70390-94-2
    Catalog No.: 103824
    Purity: 95%
    MF: C9H7ClN2S
    MW: 210.689
    Storage: 2-8 degree Celsius
  9. 5,5'-(butane-1,4-diyl)bis(1,3,4-thiadiazol-2-amine)

    CAS No.: 98558-04-4
    Catalog No.: 104599
    Purity: 95%
    MF: C8H12N6S2
    MW: 256.36
    Storage: 2-8 degree Celsius
  10. 1-(1,2,3-thiadiazol-5-yl)ethanone

    CAS No.: 136918-88-2
    Catalog No.: 106141
    Purity: 95%
    MF: C4H4N2OS
    MW: 128.156
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 375 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5