•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Tetrazoles

Set Ascending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3
  1. 5-(Methylsulfonyl)-1-phenyl-1H-tetrazole

    CAS No.: 3206-44-8
    Catalog No.: 198796
    Purity: 95%
    MF: C8H8N4O2S
    MW: 224.245
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)C1=NN=NN1C1=CC=CC=C1
  2. 2-benzyl-2H-tetrazole-5-carboxylic acid

    CAS No.: 55408-13-4
    Catalog No.: ZB1066
    Purity: 95%
    MF: C9H8N4O2
    MW: 204.189
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1N=C(N=N1)C(=O)O
  3. (E)-methyl 3-(5-benzyl-4-(2H-tetrazol-5-yl)thiophen-2-yl)acrylate

    CAS No.: 1073313-80-0
    Catalog No.: 193448
    Purity: 95%
    MF: C16H14N4O2S
    MW: 326.381
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)C1=C(C=C(S1)/C=C/C(=O)OC)C=1N=NNN1
  4. 5-(thiophen-3-yl)-2H-tetrazole

    CAS No.: 59918-86-4
    Catalog No.: 193447
    Purity: 95%
    MF: C5H4N4S
    MW: 152.182
    Storage: 2-8 degree Celsius
    SMILES: S1C=C(C=C1)C=1N=NNN1
  5. 5-(thiophen-3-yl)-2-trityl-2H-tetrazole

    CAS No.: 908588-09-0
    Catalog No.: 193444
    Purity: 95%
    MF: C24H18N4S
    MW: 394.503
    Storage: 2-8 degree Celsius
    SMILES: S1C=C(C=C1)C=1N=NN(N1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
  6. 5-(azetidin-3-yl)-2H-tetrazole hydrochloride

    CAS No.: 950691-49-3
    Catalog No.: 169706
    Purity: 95%
    MF: C4H8ClN5
    MW: 161.596
    Storage: 2-8 degree Celsius
    SMILES: Cl.C1NCC1C1=NNN=N1
  7. 5-(chloromethyl)-1H-tetrazole

    CAS No.: 55408-11-2
    Catalog No.: 147573
    Purity: 95%
    MF: C2H3ClN4
    MW: 118.527
    Storage: 2-8 degree Celsius
    SMILES: ClCC1=NN=NN1
  8. LM10

    CAS No.: 1316695-35-8
    Catalog No.: 104221
    Purity: 95%
    MF: C11H8FN5
    MW: 229.218
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C=C1)C(\C=C\C1=NN=NN1)=CN2
  9. 5-(azetidin-3-yl)-2H-tetrazole

    CAS No.: 950725-13-0
    Catalog No.: TQP1585
    Purity: 95%
    MF: C4H7N5
    MW: 125.135
    Storage: 2-8 degree Celsius
    SMILES: N1CC(C1)C=1N=NNN1
  10. 2H-1,2,3,4-tetrazole-5-carboxylic acid

    CAS No.: 75773-99-8
    Catalog No.: 182296
    Purity: 95%
    MF: C2H2N4O2
    MW: 114.064
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=NNN=N1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3