•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Tetrazoles

Set Descending Direction

   

Items 31 to 40 of 107 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 2-(5-sulfanylidene-2,5-dihydro-1H-1,2,3,4-tetrazol-1-yl)acetic acid

    CAS No.: 57658-36-3
    Catalog No.: 153300
    Purity: 95%
    MF: C3H4N4O2S
    MW: 160.158
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CN1NN=NC1=S
  2. 5-(ethylsulfanyl)-2H-1,2,3,4-tetrazole

    CAS No.: 89797-68-2
    Catalog No.: 154037
    Purity: 95%
    MF: C3H6N4S
    MW: 130.176
    Storage: 2-8 degree Celsius
    SMILES: CCSC1=NNN=N1
  3. 2-(2H-1,2,3,4-tetrazol-5-yl)ethan-1-ol

    CAS No.: 17587-08-5
    Catalog No.: 157453
    Purity: 95%
    MF: C3H6N4O
    MW: 114.108
    Storage: 2-8 degree Celsius
    SMILES: OCCC1=NNN=N1
  4. 5-(4-bromo-benzyl)-2H-tetrazole

    CAS No.: 127152-64-1
    Catalog No.: 163133
    Purity: 95%
    MF: C8H7BrN4
    MW: 239.076
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(CC2=NNN=N2)C=C1
  5. 5-(4-bromo-3-methyl-phenyl)-2H-tetrazole

    CAS No.: 885278-34-2
    Catalog No.: 163134
    Purity: 95%
    MF: C8H7BrN4
    MW: 239.076
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(Br)C=CC(=C1)C1=NNN=N1
  6. 5-(3-chloro-phenyl)-2H-tetrazole

    CAS No.: 41421-28-7
    Catalog No.: 163138
    Purity: 95%
    MF: C7H5ClN4
    MW: 180.598
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC(=C1)C1=NNN=N1
  7. 5-(3-bromo-phenyl)-2H-tetrazole

    CAS No.: 3440-99-1
    Catalog No.: 163140
    Purity: 95%
    MF: C7H5BrN4
    MW: 225.049
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=CC(=C1)C1=NNN=N1
  8. 5-(3-bromo-4-methoxy-phenyl)-2H-tetrazole

    CAS No.: 191602-76-3
    Catalog No.: 163141
    Purity: 95%
    MF: C8H7BrN4O
    MW: 255.075
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(Br)C=C(C=C1)C1=NNN=N1
  9. 5-(3-bromo-4-fluoro-phenyl)-2H-tetrazole

    CAS No.: 874784-10-8
    Catalog No.: 163142
    Purity: 95%
    MF: C7H4BrFN4
    MW: 243.039
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(Br)C=C(C=C1)C1=NNN=N1
  10. 5-(2-chloro-ethyl)-2H-tetrazole

    CAS No.: 18755-46-9
    Catalog No.: 163143
    Purity: 95%
    MF: C3H5ClN4
    MW: 132.554
    Storage: 2-8 degree Celsius
    SMILES: ClCCC1=NNN=N1
Loading ...Load More ...
Set Descending Direction

   

Items 31 to 40 of 107 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6