•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Tetralones

Set Descending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 7-nitro-1-tetralone

    CAS No.: 40353-34-2
    Catalog No.: 144292
    Purity: 95%
    MF: C10H9NO3
    MW: 191.186
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC2=C(CCCC2=O)C=C1
  2. 6,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-one

    CAS No.: 895534-38-0
    Catalog No.: 134104
    Purity: 95%
    MF: C10H8F2O
    MW: 182.169
    Storage: 2-8 degree Celsius
  3. 6-methyl-1-tetralone

    CAS No.: 51015-29-3
    Catalog No.: 134107
    Purity: 95%
    MF: C11H12O
    MW: 160.216
    Storage: 2-8 degree Celsius
  4. 7-chloro-1-tetralone

    CAS No.: 26673-32-5
    Catalog No.: 134108
    Purity: 95%
    MF: C10H9ClO
    MW: 180.634
    Storage: 2-8 degree Celsius
  5. 5,7-dibromo-3,4-dihydro-2H-naphthalen-1-one

    CAS No.: 159639-61-9
    Catalog No.: 134109
    Purity: 95%
    MF: C10H8Br2O
    MW: 303.981
    Storage: 2-8 degree Celsius
  6. 7-fluoro-1-tetralone

    CAS No.: 2840-44-0
    Catalog No.: 134184
    Purity: 95%
    MF: C10H9FO
    MW: 164.179
    Storage: 2-8 degree Celsius
  7. 5,7-difluoro-3,4-dihydro-2H-naphthalen-1-one

    CAS No.: 110931-79-8
    Catalog No.: 134206
    Purity: 95%
    MF: C10H8F2O
    MW: 182.169
    Storage: 2-8 degree Celsius
  8. 5-nitro-3,4-dihydronaphthalen-1(2H)-one

    CAS No.: 51114-73-9
    Catalog No.: 134776
    Purity: 95%
    MF: C10H9NO3
    MW: 191.186
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC=CC2=C1CCCC2=O
  9. 6,7-dimethoxy-1-tetralone

    CAS No.: 13575-75-2
    Catalog No.: 143535
    Purity: 95%
    MF: C12H14O3
    MW: 206.241
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C1OC)C(=O)CCC2
  10. 5-bromo-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-one

    CAS No.: 1260007-55-3
    Catalog No.: 134052
    Purity: 95%
    MF: C10H8BrFO
    MW: 243.075
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4