•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Tetrahydrofurans

Set Descending Direction

   

Items 1 to 10 of 151 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 2-oxotetrahydrofuran-3-carboxylate

    CAS No.: 19406-00-9
    Catalog No.: 100260
    Purity: 95%
    MF: C6H8O4
    MW: 144.126
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1CCOC1=O
  2. (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol

    CAS No.: 4099-88-1
    Catalog No.: 100604
    Purity: 95%
    MF: C8H14O5
    MW: 190.195
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12OC(C)(C)O[C@]1([H])[C@@H](CO)OC2O
  3. 2,2-dimethyl(2-tetrahydrofurylidene)-1,3-dioxane-4,6-dione

    CAS No.: 145122-43-6
    Catalog No.: 100802
    Purity: 95%
    MF: C10H12O5
    MW: 212.201
    Storage: 2-8 degree Celsius
  4. (2R,3R,4S,5R)-2-(4-amino-5-fluoro-2-oxopyrimidin-1(2H)-yl)-5-methyltetrahydrofuran-3,4-diyl diacetate

    CAS No.: 161599-46-8
    Catalog No.: 101017
    Purity: 95%
    MF: C13H16FN3O6
    MW: 329.284
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1O[C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)N1C=C(F)C(N)=NC1=O
  5. (2S,3R,4S,5R)-5-methyltetrahydrofuran-2,3,4-triyl triacetate

    CAS No.: 27821-07-4
    Catalog No.: 101019
    Purity: 95%
    MF: C11H16O7
    MW: 260.242
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O
  6. (S)-tetrahydrofuran-3-amine hydrochloride

    CAS No.: 204512-95-8
    Catalog No.: 101548
    Purity: 95%
    MF: C4H10ClNO
    MW: 123.583
    Storage: 2-8 degree Celsius
  7. (R)-tetrahydrofuran-3-amine 4-methylbenzenesulfonate

    CAS No.: 111769-27-8
    Catalog No.: 101553
    Purity: 95%
    MF: C11H17NO4S
    MW: 259.327
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1CCOC1.CC1=CC=C(C=C1)S(O)(=O)=O
  8. (3aR,4S,5R,6aS)-5-hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one

    CAS No.: 32233-40-2
    Catalog No.: 102180
    Purity: 95%
    MF: C8H12O4
    MW: 172.18
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12C[C@@H](O)[C@H](CO)[C@@]1([H])CC(=O)O2
  9. (R)-tetrahydrofuran-3-amine

    CAS No.: 111769-26-7
    Catalog No.: 102200
    Purity: 95%
    MF: C4H9NO
    MW: 87.122
    Storage: 2-8 degree Celsius
  10. (S)-(tetrahydrofuran-2-yl)methanol

    CAS No.: 57203-01-7
    Catalog No.: 102205
    Purity: 95%
    MF: C5H10O2
    MW: 102.133
    Storage: 2-8 degree Celsius
    SMILES: OC[C@@H]1CCCO1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 151 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5