•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Tetrahydrofurans

Set Ascending Direction

   

Items 1 to 10 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (S)-methyl 5-oxotetrahydrofuran-2-carboxylate

    CAS No.: 21461-85-8
    Catalog No.: 126084
    Purity: 95%
    MF: C6H8O4
    MW: 144.126
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)[C@@H]1CCC(=O)O1
  2. 3-(2-chloroethyl)dihydrofuran-2(3H)-one

    CAS No.: 803688-24-6
    Catalog No.: 182946
    Purity: 95%
    MF: C6H9ClO2
    MW: 148.589
    Storage: 2-8 degree Celsius
    SMILES: ClCCC1CCOC1=O
  3. cis tert-butyl ((3S,4R)-4-aminotetrahydrofuran-3-yl)carbamate

    CAS No.: 1628794-75-1
    Catalog No.: 184665
    Purity: 95%
    MF: C9H18N2O3
    MW: 202.254
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N[C@@H]1COC[C@@H]1N
  4. (3S,5S)-5-(Hydroxymethyl)tetrahydrofuran-3-ol

    CAS No.: 204509-08-0
    Catalog No.: 188610
    Purity: 95%
    MF: C5H10O3
    MW: 118.132
    Storage: 2-8 degree Celsius
    SMILES: OC[C@@H]1C[C@@H](CO1)O
  5. (3S,4S)-4-(4-bromophenoxy)tetrahydrofuran-3-amine

    CAS No.: 1258963-53-9
    Catalog No.: 190140
    Purity: 95%
    MF: C10H12BrNO2
    MW: 258.115
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(O[C@H]2[C@H](COC2)N)C=C1
  6. N-((3S,4S)-4-(4-bromophenoxy)tetrahydrofuran-3-yl)propane-2-sulfonamide

    CAS No.: 1258963-57-3
    Catalog No.: 190894
    Purity: 95%
    MF: C13H18BrNO4S
    MW: 364.261
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(O[C@H]2[C@H](COC2)NS(=O)(=O)C(C)C)C=C1
  7. methyl 2-oxotetrahydrofuran-3-carboxylate

    CAS No.: 19406-00-9
    Catalog No.: 100260
    Purity: 95%
    MF: C6H8O4
    MW: 144.126
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1CCOC1=O
  8. (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol

    CAS No.: 4099-88-1
    Catalog No.: 100604
    Purity: 95%
    MF: C8H14O5
    MW: 190.195
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12OC(C)(C)O[C@]1([H])[C@@H](CO)OC2O
  9. (S)-(tetrahydrofuran-2-yl)methanol

    CAS No.: 57203-01-7
    Catalog No.: 102205
    Purity: 95%
    MF: C5H10O2
    MW: 102.133
    Storage: 2-8 degree Celsius
    SMILES: OC[C@@H]1CCCO1
  10. (S)-(tetrahydrofuran-2-yl)methanamine

    CAS No.: 7175-81-7
    Catalog No.: 106545
    Purity: 95%
    MF: C5H11NO
    MW: 101.149
    Storage: 2-8 degree Celsius
    SMILES: NC[C@@H]1CCCO1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5