•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonylfluorides

Set Ascending Direction

   

Items 11 to 20 of 132 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-carbamoylbenzene-1-sulfonylfluoride

    CAS No.: 454-94-4
    Catalog No.: WLZ2694
    Purity: 95%
    MF: C7H6FNO3S
    MW: 203.194
    Storage: 2-8 degree Celsius
    SMILES: C(N)(=O)C=1C=C(C=CC1)S(=O)(=O)F
  2. 3,4-dichlorobenzene-1-sulfonylfluoride

    CAS No.: 60191-50-6
    Catalog No.: WLZ2699
    Purity: 95%
    MF: C6H3Cl2FO2S
    MW: 229.059
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=CC1Cl)S(=O)(=O)F
  3. azetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185905
    Purity: 95%
    MF: C3H6FNO2S
    MW: 139.151
    Storage: 2-8 degree Celsius
    SMILES: N1(CCC1)S(=O)(=O)F
  4. 3-fluoroazetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185906
    Purity: 95%
    MF: C3H5F2NO2S
    MW: 157.141
    Storage: 2-8 degree Celsius
    SMILES: FC1CN(C1)S(=O)(=O)F
  5. 3-methoxyazetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185907
    Purity: 95%
    MF: C4H8FNO3S
    MW: 169.177
    Storage: 2-8 degree Celsius
    SMILES: COC1CN(C1)S(=O)(=O)F
  6. 3-methylazetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185908
    Purity: 95%
    MF: C4H8FNO2S
    MW: 153.178
    Storage: 2-8 degree Celsius
    SMILES: CC1CN(C1)S(=O)(=O)F
  7. 3-hydroxyazetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185909
    Purity: 95%
    MF: C3H6FNO3S
    MW: 155.15
    Storage: 2-8 degree Celsius
    SMILES: OC1CN(C1)S(=O)(=O)F
  8. 3-aminoazetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185910
    Purity: 95%
    MF: C3H7FN2O2S
    MW: 154.166
    Storage: 2-8 degree Celsius
    SMILES: NC1CN(C1)S(=O)(=O)F
  9. 3-cyanoazetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185911
    Purity: 95%
    MF: C4H5FN2O2S
    MW: 164.161
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C1CN(C1)S(=O)(=O)F
  10. 3-(aminomethyl)azetidine-1-sulfonyl fluoride

    CAS No.: NA
    Catalog No.: 185912
    Purity: 95%
    MF: C4H9FN2O2S
    MW: 168.193
    Storage: 2-8 degree Celsius
    SMILES: NCC1CN(C1)S(=O)(=O)F
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 132 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5