•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonylchlorides(chlorosulfonyl)

Set Ascending Direction

   

Items 61 to 70 of 264 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 3-chloro-4-(difluoromethoxy)benzene-1-sulfonyl chloride

    CAS No.: 1016714-35-4
    Catalog No.: GS3183
    Purity: 95%
    MF: C7H4Cl2F2O3S
    MW: 277.075
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=CC1OC(F)F)S(=O)(=O)Cl
  2. 4-fluoro-3-(methylsulfonyl)benzene-1-sulfonyl chloride

    CAS No.: 1188525-46-3
    Catalog No.: GS3184
    Purity: 95%
    MF: C7H6ClFO4S2
    MW: 272.706
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=C(C=C1)S(=O)(=O)Cl)S(=O)(=O)C
  3. 6-bromonaphthalene-2-sulfonyl chloride

    CAS No.: 50637-98-4
    Catalog No.: GS3185
    Purity: 95%
    MF: C10H6BrClO2S
    MW: 305.58
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C=CC(=CC2=CC1)S(=O)(=O)Cl
  4. 3-fluoro-4-(trifluoromethyl)benzene-1-sulfonyl chloride

    CAS No.: 694472-01-0
    Catalog No.: GS3186
    Purity: 95%
    MF: C7H3ClF4O2S
    MW: 262.611
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=C(C=CC1C(F)(F)F)S(=O)(=O)Cl
  5. 3-bromo-4-(trifluoromethoxy)benzene-1-sulfonyl chloride

    CAS No.: 883146-06-3
    Catalog No.: GS3187
    Purity: 95%
    MF: C7H3BrClF3O3S
    MW: 339.516
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=CC1OC(F)(F)F)S(=O)(=O)Cl
  6. 6-methylnaphthalene-2-sulfonyl chloride

    CAS No.: 1875-72-5
    Catalog No.: GS3188
    Purity: 95%
    MF: C11H9ClO2S
    MW: 240.711
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C2C=CC(=CC2=CC1)S(=O)(=O)Cl
  7. 4-chlorobenzene-1,3-disulfonyl dichloride

    CAS No.: 2891-17-0
    Catalog No.: GS3189
    Purity: 95%
    MF: C6H3Cl3O4S2
    MW: 309.579
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)S(=O)(=O)Cl)S(=O)(=O)Cl
  8. 3-acetamido-4-methylbenzene-1-sulfonyl chloride

    CAS No.: 13632-46-7
    Catalog No.: GS3190
    Purity: 95%
    MF: C9H10ClNO3S
    MW: 247.703
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)NC=1C=C(C=CC1C)S(=O)(=O)Cl
  9. 4-chloro-3-(difluoromethoxy)benzene-1-sulfonyl chloride

    CAS No.: 929341-75-3
    Catalog No.: GS3191
    Purity: 95%
    MF: C7H4Cl2F2O3S
    MW: 277.075
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)S(=O)(=O)Cl)OC(F)F
  10. 1-methyl-1,2,3,4-tetrahydroquinoline-7-sulfonyl chloride

    CAS No.: 947498-98-8
    Catalog No.: GS3192
    Purity: 95%
    MF: C10H12ClNO2S
    MW: 245.731
    Storage: 2-8 degree Celsius
    SMILES: CN1CCCC2=CC=C(C=C12)S(=O)(=O)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 264 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9