•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonylchlorides(chlorosulfonyl)

Set Descending Direction

   

Items 41 to 50 of 264 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 1-acetylindoline-5-sulfonyl chloride

    CAS No.: 303019-19-4
    Catalog No.: GS3162
    Purity: 95%
    MF: C10H10ClNO3S
    MW: 259.714
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)N1CCC2=CC(=CC=C12)S(=O)(=O)Cl
  2. 3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-7-sulfonyl chloride

    CAS No.: 868962-24-7
    Catalog No.: GS3163
    Purity: 95%
    MF: C8H6ClNO4S
    MW: 247.659
    Storage: 2-8 degree Celsius
    SMILES: O=C1COC2=C(N1)C=CC(=C2)S(=O)(=O)Cl
  3. 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-sulfonyl chloride

    CAS No.: 952424-09-8
    Catalog No.: GS3164
    Purity: 95%
    MF: C9H8ClNO3S
    MW: 245.687
    Storage: 2-8 degree Celsius
    SMILES: O=C1NCCC2=CC=C(C=C12)S(=O)(=O)Cl
  4. 4-ethoxy-3-fluorobenzene-1-sulfonyl chloride

    CAS No.: 1016756-58-3
    Catalog No.: GS3165
    Purity: 95%
    MF: C8H8ClFO3S
    MW: 238.667
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC1=C(C=C(C=C1)S(=O)(=O)Cl)F
  5. 2-(2-chloro-4-(chlorosulfonyl)phenoxy)acetic acid

    CAS No.: 1017055-32-1
    Catalog No.: GS3166
    Purity: 95%
    MF: C8H6Cl2O5S
    MW: 285.104
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(OCC(=O)O)C=CC(=C1)S(=O)(=O)Cl
  6. 2,3-dichloroquinoxaline-6-sulfonyl chloride

    CAS No.: 2149-05-5
    Catalog No.: GS3167
    Purity: 95%
    MF: C8H3Cl3N2O2S
    MW: 297.55
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=CC=C(C=C2N=C1Cl)S(=O)(=O)Cl
  7. 2-methylbenzo[d]oxazole-6-sulfonyl chloride

    CAS No.: 52206-51-6
    Catalog No.: GS3168
    Purity: 95%
    MF: C8H6ClNO3S
    MW: 231.66
    Storage: 2-8 degree Celsius
    SMILES: CC=1OC2=C(N1)C=CC(=C2)S(=O)(=O)Cl
  8. 3-methyl-4-nitrobenzene-1-sulfonyl chloride

    CAS No.: 78726-75-7
    Catalog No.: GS3169
    Purity: 95%
    MF: C7H6ClNO4S
    MW: 235.648
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C(C=CC1[N+](=O)[O-])S(=O)(=O)Cl
  9. 4-(chlorosulfonyl)-2-hydroxybenzoic acid

    CAS No.: 98273-15-5
    Catalog No.: GS3170
    Purity: 95%
    MF: C7H5ClO5S
    MW: 236.632
    Storage: 2-8 degree Celsius
    SMILES: ClS(=O)(=O)C1=CC(=C(C(=O)O)C=C1)O
  10. benzo[b]thiophene-5-sulfonyl chloride

    CAS No.: 128852-05-1
    Catalog No.: GS3171
    Purity: 95%
    MF: C8H5ClO2S2
    MW: 232.713
    Storage: 2-8 degree Celsius
    SMILES: S1C2=C(C=C1)C=C(C=C2)S(=O)(=O)Cl
Loading ...Load More ...
Set Descending Direction

   

Items 41 to 50 of 264 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7