•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonylchlorides(chlorosulfonyl)

Set Ascending Direction

   

Items 11 to 20 of 264 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-fluoro-2-methylbenzene-1-sulfonyl chloride

    CAS No.: 875166-92-0
    Catalog No.: 196662
    Purity: 95%
    MF: C7H6ClFO2S
    MW: 208.641
    Storage: 2-8 degree Celsius
    SMILES: FC=1C(=C(C=CC1)S(=O)(=O)Cl)C
  2. 4-methoxy-2-nitrobenzene-1-sulfonyl chloride

    CAS No.: 18092-54-1
    Catalog No.: 196663
    Purity: 95%
    MF: C7H6ClNO5S
    MW: 251.647
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(=C(C=C1)S(=O)(=O)Cl)[N+](=O)[O-]
  3. methyl 2-bromo-5-(chlorosulfonyl)benzoate

    CAS No.: 924867-87-8
    Catalog No.: GS3133
    Purity: 95%
    MF: C8H6BrClO4S
    MW: 313.556
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=O)OC)C=C(C=C1)S(=O)(=O)Cl
  4. 7-methoxynaphthalene-2-sulfonyl chloride

    CAS No.: 56875-60-6
    Catalog No.: GS3134
    Purity: 95%
    MF: C11H9ClO3S
    MW: 256.71
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2C=CC(=CC2=C1)S(=O)(=O)Cl
  5. 2,4-dioxo-2,4-dihydro-1H-benzo[d][1,3]oxazine-6-sulfonyl chloride

    CAS No.: 74171-22-5
    Catalog No.: GS3135
    Purity: 95%
    MF: C8H4ClNO5S
    MW: 261.642
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC2=C(C(O1)=O)C=C(C=C2)S(=O)(=O)Cl
  6. 3-bromo-4-chlorobenzene-1-sulfonyl chloride

    CAS No.: 195201-10-6
    Catalog No.: GS3136
    Purity: 95%
    MF: C6H3BrCl2O2S
    MW: 289.965
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=CC1Cl)S(=O)(=O)Cl
  7. 4-methoxy-3-(methylcarbamoyl)benzene-1-sulfonyl chloride

    CAS No.: 918933-10-5
    Catalog No.: GS3137
    Purity: 95%
    MF: C9H10ClNO4S
    MW: 263.702
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)NC
  8. methyl 2-chloro-5-(chlorosulfonyl)benzoate

    CAS No.: 924859-46-1
    Catalog No.: GS3138
    Purity: 95%
    MF: C8H6Cl2O4S
    MW: 269.105
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=O)OC)C=C(C=C1)S(=O)(=O)Cl
  9. benzofuran-6-sulfonyl chloride

    CAS No.: 1314920-96-1
    Catalog No.: GS3139
    Purity: 95%
    MF: C8H5ClO3S
    MW: 216.645
    Storage: 2-8 degree Celsius
    SMILES: O1C=CC2=C1C=C(C=C2)S(=O)(=O)Cl
  10. 3-bromoquinoline-7-sulfonyl chloride

    CAS No.: 1956331-36-4
    Catalog No.: GS3140
    Purity: 95%
    MF: C9H5BrClNO2S
    MW: 306.568
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=NC2=CC(=CC=C2C1)S(=O)(=O)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 264 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5