•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonylchlorides(chlorosulfonyl)

Set Descending Direction

   

Items 1 to 10 of 395 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-(chlorosulfonyl)phenyl isobutyrate

    CAS No.: 150374-99-5
    Catalog No.: 101473
    Purity: 95%
    MF: C10H11ClO4S
    MW: 262.714
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C(=O)OC1=CC=C(C=C1)S(Cl)(=O)=O
  2. tert-butyl 4-(chlorosulfonyl)phenylcarbamate

    CAS No.: 269747-25-3
    Catalog No.: 101511
    Purity: 95%
    MF: C11H14ClNO4S
    MW: 291.756
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC1=CC=C(C=C1)S(Cl)(=O)=O
  3. methyl 3-(chlorosulfonyl)-4-methylbenzoate

    CAS No.: 372198-41-9
    Catalog No.: 102058
    Purity: 95%
    MF: C9H9ClO4S
    MW: 248.687
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC=C(C)C(=C1)S(Cl)(=O)=O
  4. benzyl 3-(chlorosulfonyl)pyrrolidine-1-carboxylate

    CAS No.: 1035173-74-0
    Catalog No.: 105682
    Purity: 95%
    MF: C12H14ClNO4S
    MW: 303.767
    Storage: 2-8 degree Celsius
  5. ethyl 3-(3-(chlorosulfonyl)phenyl)acrylate

    CAS No.: 1159834-58-8
    Catalog No.: 105835
    Purity: 95%
    MF: C11H11ClO4S
    MW: 274.725
    Storage: 2-8 degree Celsius
  6. methyl 2-(chlorosulfonyl)benzoate

    CAS No.: 26638-43-7
    Catalog No.: 108173
    Purity: 95%
    MF: C8H7ClO4S
    MW: 234.66
    Storage: 2-8 degree Celsius
  7. 5-chlorosulfonyl-2-ethoxybenzoic acid

    CAS No.: 200575-16-2
    Catalog No.: 108902
    Purity: 95%
    MF: C9H9ClO5S
    MW: 264.686
    Storage: 2-8 degree Celsius
  8. 4-(chlorosulfonyl)benzoic acid

    CAS No.: 10130-89-9
    Catalog No.: 112232
    Purity: 95%
    MF: C7H5ClO4S
    MW: 220.633
    Storage: 2-8 degree Celsius
  9. 3-(chlorosulfonyl)benzoyl chloride

    CAS No.: 4052-92-0
    Catalog No.: 113897
    Purity: 95%
    MF: C7H4Cl2O3S
    MW: 239.079
    Storage: 2-8 degree Celsius
  10. methyl 4-(chlorosulfonyl)benzoate

    CAS No.: 69812-51-7
    Catalog No.: 129052
    Purity: 95%
    MF: C8H7ClO4S
    MW: 234.66
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC=C(C=C1)S(Cl)(=O)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 395 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5