•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonamide

Set Ascending Direction

   

Items 31 to 40 of 460 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. N-(4-((2-chloropyrimidin-4-yl)amino)phenyl)-2,4,6-trimethylbenzenesulfonamide

    CAS No.: 2556836-38-3
    Catalog No.: TQR1488
    Purity: 95%
    MF: C19H19ClN4O2S
    MW: 402.907
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC(=N1)NC1=CC=C(C=C1)NS(=O)(=O)C1=C(C=C(C=C1C)C)C
  2. 2,6-dichloro-4-(3-hydroxypropyl)-N-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzenesulfonamide

    CAS No.: 2375536-99-3
    Catalog No.: TQR1535
    Purity: 95%
    MF: C16H21Cl2N3O3S
    MW: 406.335
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=CC(=C1)CCCO)Cl)S(=O)(=O)N(C=1C(=NN(C1C)C)C)C
  3. N-(5-bromo-2-methoxypyridin-3-yl)benzenesulfonamide

    CAS No.: 1086063-47-9
    Catalog No.: TQR1539
    Purity: 95%
    MF: C12H11BrN2O3S
    MW: 343.202
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C(=NC1)OC)NS(=O)(=O)C1=CC=CC=C1
  4. N-(5-bromo-2-methoxypyridin-3-yl)-4-fluorobenzenesulfonamide

    CAS No.: 1425046-27-0
    Catalog No.: TQR1540
    Purity: 95%
    MF: C12H10BrFN2O3S
    MW: 361.192
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C(=NC1)OC)NS(=O)(=O)C1=CC=C(C=C1)F
  5. 3-bromo-N-((7-fluoro-4-hydroxychroman-4-yl)methyl)benzenesulfonamide

    CAS No.: 2378618-75-6
    Catalog No.: TQR1553
    Purity: 95%
    MF: C16H15BrFNO4S
    MW: 416.268
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=CC1)S(=O)(=O)NCC1(CCOC2=CC(=CC=C12)F)O
  6. 2-chloro-N,N-diethyl-5-nitrobenzenesulfonamide

    CAS No.: 4750-91-8
    Catalog No.: TQR1594
    Purity: 95%
    MF: C10H13ClN2O4S
    MW: 292.744
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N(CC)CC
  7. 2-chloro-N-methyl-5-nitro-N-octadecylbenzenesulfonamide

    CAS No.: 118938-28-6
    Catalog No.: TQR1595
    Purity: 95%
    MF: C25H43ClN2O4S
    MW: 503.149
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N(CCCCCCCCCCCCCCCCCC)C
  8. 2-chloro-N,N-dimethyl-5-nitrobenzenesulfonamide

    CAS No.: 10372-90-4
    Catalog No.: TQR1596
    Purity: 95%
    MF: C8H9ClN2O4S
    MW: 264.69
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N(C)C
  9. 2-chloro-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide

    CAS No.: 68901-10-0
    Catalog No.: TQR1597
    Purity: 95%
    MF: C14H13ClN2O4S
    MW: 340.788
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)NC1=C(C=C(C=C1)C)C
  10. 2-chloro-N-methyl-5-nitrobenzenesulfonamide

    CAS No.: 89793-16-8
    Catalog No.: TQR1598
    Purity: 95%
    MF: C7H7ClN2O4S
    MW: 250.663
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)NC
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 460 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6