•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Stem Cells & Wnt

Set Ascending Direction

   

Items 21 to 30 of 59 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. WAY 316606

    CAS No.: 915759-45-4
    Catalog No.: 186452
    Purity: 95%
    MF: C18H19F3N2O4S2
    MW: 448.488
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)S(=O)(=O)C=1C=CC(=C(C1)S(=O)(=O)NC1CCNCC1)C(F)(F)F
  2. SKL2001

    CAS No.: 909089-13-0
    Catalog No.: 186463
    Purity: 95%
    MF: C14H14N4O3
    MW: 286.291
    Storage: 2-8 degree Celsius
    SMILES: N1(C=NC=C1)CCCNC(=O)C1=NOC(=C1)C=1OC=CC1
  3. THZ531

    CAS No.: 1702809-17-3
    Catalog No.: 186469
    Purity: 95%
    MF: C30H32ClN7O2
    MW: 558.086
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=NC(=NC1)N[C@H]1CN(CCC1)C(=O)C1=CC=C(C=C1)NC(\C=C\CN(C)C)=O)C1=CNC2=CC=CC=C12
  4. K-975

    CAS No.: 2563855-03-6
    Catalog No.: 194751
    Purity: 95%
    MF: C16H14ClNO2
    MW: 287.746
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(OC=2C=C(C=CC2C)NC(C=C)=O)C=C1
  5. TED-347

    CAS No.: 2378626-29-8
    Catalog No.: 194831
    Purity: 95%
    MF: C15H11ClF3NO
    MW: 313.706
    Storage: 2-8 degree Celsius
    SMILES: ClCC(=O)C1=C(C=CC=C1)NC1=CC(=CC=C1)C(F)(F)F
  6. β-catenin-IN-2

    CAS No.: 1458664-10-2
    Catalog No.: 194847
    Purity: 95%
    MF: C15H14FN3
    MW: 255.296
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=CC2=C(NC(=N2)C2=CC=C(N(C)C)C=C2)C1
  7. MSAB

    CAS No.: 173436-66-3
    Catalog No.: WLZ0179
    Purity: 95%
    MF: C15H15NO4S
    MW: 305.355
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)S(=O)(=O)NC=1C=C(C(=O)OC)C=CC1
  8. IHR-1

    CAS No.: 548779-60-8
    Catalog No.: WLZ0244
    Purity: 95%
    MF: C20H12Cl4N2O2
    MW: 454.14
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=C(C=C1)NC(C1=C(C=CC(=C1)Cl)Cl)=O)NC(C1=C(C=CC(=C1)Cl)Cl)=O
  9. GA-017

    CAS No.: 2351906-74-4
    Catalog No.: WLZ0413
    Purity: 95%
    MF: C18H21N3O4
    MW: 343.383
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=CC(=C1C)O)C(CC)=NNC(=O)NCC1=CC(=CC=C1)O
  10. Gigantol

    CAS No.: 67884-30-4
    Catalog No.: ZB1611
    Purity: 95%
    MF: C16H18O4
    MW: 274.316
    Storage: 2-8 degree Celsius
    SMILES: OC=1C=C(CCC=2C=CC(=C(C2)O)OC)C=C(C1)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 59 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5