•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Spiros

Set Descending Direction

   

Items 51 to 60 of 583 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. (S)-ethyl 4-amino-6-bromospiro[chroman-2,4'-piperidine]-1'-carboxylate hydrochloride

    CAS No.: 2260727-69-1
    Catalog No.: TQR1703
    Purity: 95%
    MF: C16H22BrClN2O3
    MW: 405.72
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@H]1CC2(CCN(CC2)C(=O)OCC)OC2=CC=C(C=C12)Br
  2. 4,6-difluoro-1-(2-hydroxyethyl)spiro[indoline-3,4'-piperidin]-2-one

    CAS No.: 2345639-86-1
    Catalog No.: TQR1790
    Purity: 95%
    MF: C14H16F2N2O2
    MW: 282.29
    Storage: 2-8 degree Celsius
    SMILES: FC1=C2C(=CC(=C1)F)N(C(C21CCNCC1)=O)CCO
  3. benzyl 4,6-difluoro-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate

    CAS No.: 2171390-01-3
    Catalog No.: TQR1791
    Purity: 95%
    MF: C20H18F2N2O3
    MW: 372.371
    Storage: 2-8 degree Celsius
    SMILES: FC1=C2C(=CC(=C1)F)NC(C21CCN(CC1)C(=O)OCC1=CC=CC=C1)=O
  4. 4,6-difluoro-1-methylspiro[indoline-3,4'-piperidin]-2-one

    CAS No.: 2567885-20-3
    Catalog No.: TQR1792
    Purity: 95%
    MF: C13H14F2N2O
    MW: 252.264
    Storage: 2-8 degree Celsius
    SMILES: FC1=C2C(=CC(=C1)F)N(C(C21CCNCC1)=O)C
  5. tert-butyl 4-fluoro-6-hydroxy-1-methyl-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate

    CAS No.: 2361163-07-5
    Catalog No.: TQR1793
    Purity: 95%
    MF: C18H23FN2O4
    MW: 350.39
    Storage: 2-8 degree Celsius
    SMILES: FC1=C2C(=CC(=C1)O)N(C(C21CCN(CC1)C(=O)OC(C)(C)C)=O)C
  6. benzyl 6-bromo-4-fluoro-1-methyl-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate

    CAS No.: 2567886-88-6
    Catalog No.: TQR1794
    Purity: 95%
    MF: C21H20BrFN2O3
    MW: 447.304
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=C2C(=C1)N(C(C21CCN(CC1)C(=O)OCC1=CC=CC=C1)=O)C)F
  7. 6,6-difluoro-2-azaspiro[3.3]heptane 2,2,2-trifluoroacetate

    CAS No.: 1427367-47-2
    Catalog No.: TQU0021
    Purity: 95%
    MF: C8H10F5NO2
    MW: 247.163
    Storage: 2-8 degree Celsius
    SMILES: FC(C(=O)O)(F)F.FC1(CC2(CNC2)C1)F
  8. 6,6-difluorospiro[3.3]heptan-2-amine

    CAS No.: 1354952-13-8
    Catalog No.: TQU0022
    Purity: 95%
    MF: C7H11F2N
    MW: 147.168
    Storage: 2-8 degree Celsius
    SMILES: FC1(CC2(CC(C2)N)C1)F
  9. 5-azaspiro[2.4]heptane-4,7-dione, 5-(phenylmethyl)-

    CAS No.: 129306-04-3
    Catalog No.: 101860
    Purity: 95%
    MF: C13H13NO2
    MW: 215.252
    Storage: 2-8 degree Celsius
    SMILES: O=C1CN(CC2=CC=CC=C2)C(=O)C11CC1
  10. (S)-tert-butyl (5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate

    CAS No.: 144282-37-1
    Catalog No.: 101886
    Purity: 95%
    MF: C18H26N2O2
    MW: 302.418
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N[C@@H]1CN(CC2=CC=CC=C2)CC11CC1
Loading ...Load More ...
Set Descending Direction

   

Items 51 to 60 of 583 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8