•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Spiros

Set Ascending Direction

   

Items 31 to 40 of 583 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-2-methoxyphenol

    CAS No.: 2365507-91-9
    Catalog No.: TQR0056
    Purity: 95%
    MF: C13H17NO3
    MW: 235.283
    Storage: 2-8 degree Celsius
    SMILES: C1OCC12CN(C2)CC2=CC(=C(C=C2)O)OC
  2. 4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-3-chlorophenol

    CAS No.: 1254035-91-0
    Catalog No.: TQR0057
    Purity: 95%
    MF: C12H14ClNO2
    MW: 239.702
    Storage: 2-8 degree Celsius
    SMILES: C1OCC12CN(C2)CC2=C(C=C(C=C2)O)Cl
  3. 4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-2-chlorophenol

    CAS No.: 1254036-04-8
    Catalog No.: TQR0058
    Purity: 95%
    MF: C12H14ClNO2
    MW: 239.702
    Storage: 2-8 degree Celsius
    SMILES: C1OCC12CN(C2)CC2=CC(=C(C=C2)O)Cl
  4. 2-cyclohexyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one

    CAS No.: 1092099-25-6
    Catalog No.: TQR0473
    Purity: 95%
    MF: C13H21N3O
    MW: 235.331
    Storage: 2-8 degree Celsius
    SMILES: C1(CCCCC1)C1=NC2(C(N1)=O)CCNCC2
  5. 2-((1r,4r)-4-methylcyclohexyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one dihydrochloride

    CAS No.: 1253925-60-8
    Catalog No.: TQR0474
    Purity: 95%
    MF: C14H25Cl2N3O
    MW: 322.27
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC([C@H]2CC[C@H](C)CC2)=NC13CCNCC3.[H]Cl.[H]Cl
  6. 2-(2,4-dichlorophenyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one dihydrochloride

    CAS No.: 1253923-98-6
    Catalog No.: TQR0475
    Purity: 95%
    MF: C13H15Cl4N3O
    MW: 371.095
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.ClC1=C(C=CC(=C1)Cl)C1=NC2(C(N1)=O)CCNCC2
  7. 6,6-difluorospiro[2.5]octane-1-carboxylic acid

    CAS No.: 1447943-53-4
    Catalog No.: TQR0538
    Purity: 95%
    MF: C9H12F2O2
    MW: 190.189
    Storage: 2-8 degree Celsius
    SMILES: FC1(CCC2(CC2C(=O)O)CC1)F
  8. 2-(6,6-difluorospiro[2.5]octane-1-carboxamido)acetic acid

    CAS No.: 2237221-86-0
    Catalog No.: TQR0539
    Purity: 95%
    MF: C11H15F2NO3
    MW: 247.241
    Storage: 2-8 degree Celsius
    SMILES: FC1(CCC2(CC2C(=O)NCC(=O)O)CC1)F
  9. 1-(4-methoxyphenyl)-1,3,8-triazaspiro[4.5]decan-4-one

    CAS No.: 1027-69-6
    Catalog No.: TQR0909
    Purity: 95%
    MF: C14H19N3O2
    MW: 261.325
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1)N1CNC(C12CCNCC2)=O
  10. 5-amino-2,3-dihydrospiro[indene-1,5'-oxazolidine]-2',4'-dione

    CAS No.: 1889287-59-5
    Catalog No.: TQR1495
    Purity: 95%
    MF: C11H10N2O3
    MW: 218.212
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C2CCC3(C(NC(O3)=O)=O)C2=CC1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 583 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6