•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Spiros

Set Descending Direction

   

Items 1 to 10 of 1404 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid

    CAS No.: 1199586-87-2
    Catalog No.: 100136
    Purity: 95%
    MF: C13H13BrO4
    MW: 313.147
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1(CC2(C1)OCCO2)C1=CC=C(Br)C=C1
  2. methyl 2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylate

    CAS No.: 1364663-40-0
    Catalog No.: 100137
    Purity: 95%
    MF: C14H15BrO4
    MW: 327.174
    Storage: 2-8 degree Celsius
  3. tert-butyl 2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octan-2-ylcarbamate

    CAS No.: 1199557-05-5
    Catalog No.: 100139
    Purity: 95%
    MF: C17H22BrNO4
    MW: 384.27
    Storage: 2-8 degree Celsius
  4. 2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octan-2-amine

    CAS No.: 1199556-85-8
    Catalog No.: 100140
    Purity: 95%
    MF: C12H14BrNO2
    MW: 284.153
    Storage: 2-8 degree Celsius
    SMILES: NC1(CC2(C1)OCCO2)C1=CC=C(Br)C=C1
  5. 2-(2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octan-2-yl)isoindoline-1,3-dione

    CAS No.: 1199556-86-9
    Catalog No.: 100141
    Purity: 95%
    MF: C20H16BrNO4
    MW: 414.255
    Storage: 2-8 degree Celsius
  6. tert-butyl 2'-tert-butyl-7'-oxo-6',7'-dihydro-2'H-spiro[piperidine-4,5'-pyrano[3,2-c]pyrazole]-1-carboxylate

    CAS No.: 1197815-67-0
    Catalog No.: 100283
    Purity: 95%
    MF: C19H29N3O4
    MW: 363.458
    Storage: 2-8 degree Celsius
  7. 2'-tert-butyl-2'H-spiro[piperidine-4,5'-pyrano[3,2-c]pyrazol]-7'(6'H)-one hydrochloride

    CAS No.: 1197815-65-8
    Catalog No.: 100284
    Purity: 95%
    MF: C14H22ClN3O2
    MW: 299.802
    Storage: 2-8 degree Celsius
  8. 2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octane-2-carbonitrile

    CAS No.: 1227958-64-6
    Catalog No.: 100694
    Purity: 95%
    MF: C13H12BrNO2
    MW: 294.148
    Storage: 2-8 degree Celsius
  9. 2-oxa-5-azaspiro[3,4]octane-5-carboxylic acid tert-butyl ester

    CAS No.: 1245816-30-1
    Catalog No.: 101167
    Purity: 95%
    MF: C11H19NO3
    MW: 213.277
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCCC11COC1
  10. spiro[2.5]octan-6-ylmethanol

    CAS No.: 849671-56-3
    Catalog No.: 101287
    Purity: 95%
    MF: C9H16O
    MW: 140.226
    Storage: 2-8 degree Celsius
    SMILES: OCC1CCC2(CC2)CC1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 1404 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5