•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Silanes

Set Descending Direction

   

Items 1 to 10 of 29 total

  1. 1
  2. 2
  3. 3
  1. (R)-ethyl 2-((tert-butyldimethylsilyl)oxy)propanoate

    CAS No.: 169904-58-9
    Catalog No.: TQP0264
    Purity: 95%
    MF: C11H24O3Si
    MW: 232.396
    Storage: 2-8 degree Celsius
    SMILES: [Si](C)(C)(C(C)(C)C)O[C@@H](C(=O)OCC)C
  2. 2,2-dimethyl-4H-1,3,2-benzodioxasiline

    CAS No.: 17878-03-4
    Catalog No.: WLZ3693
    Purity: 95%
    MF: C9H12O2Si
    MW: 180.279
    Storage: 2-8 degree Celsius
    SMILES: C[Si]1(OC2=C(CO1)C=CC=C2)C
  3. (4-bromo-3-nitrophenoxy)(tert-butyl)dimethylsilane

    CAS No.: 722536-62-1
    Catalog No.: WLZ3647
    Purity: 95%
    MF: C12H18BrNO3Si
    MW: 332.27
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(O[Si](C)(C)C(C)(C)C)C=C1)[N+](=O)[O-]
  4. 1,1-bis(chloromethyl)siletane

    CAS No.: 1239481-23-2
    Catalog No.: 199097
    Purity: 95%
    MF: C5H10Cl2Si
    MW: 169.127
    Storage: 2-8 degree Celsius
    SMILES: ClC[Si]1(CCC1)CCl
  5. 2-(trimethylsilyl)ethyl 2-chloroacetate

    CAS No.: 100297-89-0
    Catalog No.: ZB0325
    Purity: 95%
    MF: C7H15ClO2Si
    MW: 194.734
    Storage: 2-8 degree Celsius
    SMILES: ClCC(=O)OCC[Si](C)(C)C
  6. Tetrathiophen-2-yl-silane

    CAS No.: 17940-73-7
    Catalog No.: 187099
    Purity: 95%
    MF: C16H12S4Si
    MW: 360.626
    Storage: 2-8 degree Celsius
    SMILES: S1C(=CC=C1)[Si](C=1SC=CC1)(C=1SC=CC1)C=1SC=CC1
  7. 3,7-dibromo-5,5-dimethyl-5H-dibenzo[b,d]silole

    CAS No.: 1228595-79-6
    Catalog No.: 178738
    Purity: 95%
    MF: C14H12Br2Si
    MW: 368.144
    Storage: 2-8 degree Celsius
    SMILES: C[Si]1(C)C2=CC(Br)=CC=C2C2=C1C=C(Br)C=C2
  8. 5-(((tert-butyldimethylsilyl)oxy)methyl)-5-(((tert-butyldiphenylsilyl)oxy)methyl)dihydrofuran-2(3H)-one

    CAS No.: 1610776-18-5
    Catalog No.: TQR0529
    Purity: 95%
    MF: C28H42O4Si2
    MW: 498.812
    Storage: 2-8 degree Celsius
    SMILES: [Si](C)(C)(C(C)(C)C)OCC1(CCC(O1)=O)CO[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C(C)(C)C
  9. 5,5-bis(((tert-butyldiphenylsilyl)oxy)methyl)dihydrofuran-2(3H)-one

    CAS No.: 172843-14-0
    Catalog No.: TQR0528
    Purity: 95%
    MF: C38H46O4Si2
    MW: 622.954
    Storage: 2-8 degree Celsius
    SMILES: [Si](C1=CC=CC=C1)(C1=CC=CC=C1)(C(C)(C)C)OCC1(CCC(O1)=O)CO[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C(C)(C)C
  10. 4-(tert-butyl)-N-(2-(((tert-butyldimethylsilyl)oxy)methyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide

    CAS No.: 1454614-81-3
    Catalog No.: TQP0921
    Purity: 95%
    MF: C30H46BNO4Si
    MW: 523.599
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)C1=CC=C(C(=O)NC2=C(C(=CC=C2)B2OC(C(O2)(C)C)(C)C)CO[Si](C)(C)C(C)(C)C)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 29 total

  1. 1
  2. 2
  3. 3