•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Reference Compounds

Set Ascending Direction

   

Items 11 to 20 of 7281 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-(2-(1-(4-methoxyphenyl)cyclopropyl)pyridin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1395492-75-7
    Catalog No.: 100443
    Purity: 95%
    MF: C19H19N3OS
    MW: 337.448
    Storage: 2-8 degree Celsius
  2. 5-(2-(2-(4-(3-(dimethylamino)propoxy)phenyl)propan-2-yl)pyridin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1395492-87-1
    Catalog No.: 100444
    Purity: 95%
    MF: C23H30N4OS
    MW: 410.587
    Storage: 2-8 degree Celsius
  3. 5-(2-(2-(4-methoxyphenyl)propan-2-yl)pyridin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1395492-70-2
    Catalog No.: 100445
    Purity: 95%
    MF: C19H21N3OS
    MW: 339.464
    Storage: 2-8 degree Celsius
  4. 5-(2-(2-(4-methoxyphenyl)propan-2-yl)pyridin-4-yl)thiazol-2-amine

    CAS No.: 1395492-62-2
    Catalog No.: 100464
    Purity: 95%
    MF: C18H19N3OS
    MW: 325.437
    Storage: 2-8 degree Celsius
  5. 5-(2-(1-(4-methoxyphenyl)cyclopropyl)pyridin-4-yl)thiazol-2-amine

    CAS No.: 1395492-55-3
    Catalog No.: 100465
    Purity: 95%
    MF: C18H17N3OS
    MW: 323.421
    Storage: 2-8 degree Celsius
  6. 5-(2-benzylpyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-07-4
    Catalog No.: 100469
    Purity: 95%
    MF: C15H14N4S
    MW: 282.372
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(CC2=CC=CC=C2)=NC=C1
  7. 5-(2-(2,6-dichlorobenzyl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1163706-69-1
    Catalog No.: 100472
    Purity: 95%
    MF: C15H12Cl2N4S
    MW: 351.262
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(CC2=C(Cl)C=CC=C2Cl)=NC=C1
  8. 5-(2-((4-methoxyphenoxy)methyl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-16-5
    Catalog No.: 100474
    Purity: 95%
    MF: C16H16N4O2S
    MW: 328.397
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(OCC2=NC=CC(=N2)C2=C(C)N=C(N)S2)C=C1
  9. 5-(2-(2-fluorophenyl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-21-2
    Catalog No.: 100475
    Purity: 95%
    MF: C14H11FN4S
    MW: 286.335
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(=NC=C1)C1=CC=CC=C1F
  10. 5-(2-(2-(4-methoxyphenyl)propan-2-yl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-31-4
    Catalog No.: 100478
    Purity: 95%
    MF: C18H20N4OS
    MW: 340.452
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1)C(C)(C)C1=NC=CC(=N1)C1=C(C)N=C(N)S1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 7281 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5